Question

Помогите с химией, срочно! Дано вещество: 3-этил – 3- метилпентанол- 2. Напишите структурные формулы двух изомеров и двух гомологов этого вещества. Назовите их.

Answer 1

Ответ:

На картинке подписанные изомеры и гомологи. Ну, и формула исходного вещества

Answer 2

#### Structural Formulas of Isomers and Homologues of 3-Ethyl-3-Methylpentanol-2 The given substance, 3-ethyl-3-methylpentanol-2, belongs to the class of alcohols. To determine the structural formulas of its isomers and homologues, we need to understand the molecular structure and naming conventions. The molecular formula of 3-ethyl-3-methylpentanol-2 is C9H20O. It consists of a pentane chain (5 carbon atoms) with an ethyl group (-C2H5) attached to the third carbon atom and a methyl group (-CH3) attached to the third carbon atom. The hydroxyl group (-OH) is attached to the second carbon atom. #### Isomers of 3-Ethyl-3-Methylpentanol-2 Isomers are compounds that have the same molecular formula but different structural arrangements. In the case of 3-ethyl-3-methylpentanol-2, there are two possible isomers: 1. **2-Ethyl-3-Methylpentanol-3**: In this isomer, the ethyl group is attached to the second carbon atom, and the methyl group is attached to the third carbon atom. The hydroxyl group is attached to the third carbon atom. The structural formula is: ``` CH3-CH(CH3)-CH2-CH(CH3)-CH2-CH2-OH ``` 2. **3-Ethyl-2-Methylpentanol-3**: In this isomer, the ethyl group is attached to the third carbon atom, and the methyl group is attached to the second carbon atom. The hydroxyl group is attached to the third carbon atom. The structural formula is: ``` CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-OH ``` #### Homologues of 3-Ethyl-3-Methylpentanol-2 Homologues are compounds that belong to the same homologous series and have similar chemical properties but differ by a CH2 unit in their molecular structure. The homologues of 3-ethyl-3-methylpentanol-2 can be obtained by extending the carbon chain. Two homologues of 3-ethyl-3-methylpentanol-2 are: 1. **2-Ethyl-3-Methylhexanol-4**: In this homologue, the carbon chain is extended by one carbon atom, resulting in a total of 6 carbon atoms. The ethyl group is attached to the second carbon atom, the methyl group is attached to the third carbon atom, and the hydroxyl group is attached to the fourth carbon atom. The structural formula is: ``` CH3-CH(CH3)-CH2-CH(CH3)-CH2-CH2-CH2-OH ``` 2. **3-Ethyl-4-Methyloctanol-5**: In this homologue, the carbon chain is extended by two carbon atoms, resulting in a total of 8 carbon atoms. The ethyl group is attached to the third carbon atom, the methyl group is attached to the fourth carbon atom, and the hydroxyl group is attached to the fifth carbon atom. The structural formula is: ``` CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-OH ``` Please note that the numbering of carbon atoms in the structural formulas is based on the IUPAC nomenclature system. I hope this helps! Let me know if you have any further questions.