Question

Fe(OH)2+HNO3 ионное уравнение почему перед HNO3 стаим 2? Fe(OH)2+2HNO3=Fe(NO3)2+2H2O Fe(OH)2+2H(+)=Fe(+2)+2H2O

Answer 1

Потому что получается нитрат железа (2), т.е. нужно два нитратных остатка

Answer 2

Чтобы уравнять количество кислорода и водорода с обеих сторон, эта двойка называется коэффициент, он ставится не только у них,но и у всех молекул в любых реакций.

Answer 3

The balanced ionic equation you provided is correct:

Fe(OH)2 + 2HNO3 = Fe(NO3)2 + 2H2O

The reason why you put "2" in front of HNO3 is to balance the equation. In an ionic equation, it is essential to make sure that the number of atoms of each element is the same on both sides of the equation to satisfy the law of conservation of mass.

When Fe(OH)2 reacts with HNO3, the iron (Fe) and hydroxide (OH) ions react with the hydrogen (H) and nitrate (NO3) ions from the nitric acid (HNO3). On the left-hand side of the equation, you have one iron ion (Fe), two hydroxide ions (OH), and two nitric acid molecules (HNO3). On the right-hand side, you have one iron nitrate molecule (Fe(NO3)2) and two water molecules (H2O).

To balance the equation, you need to ensure that the number of each type of atom is the same on both sides. In this case, there are two hydrogen ions (H+) on the right side, so you need to have two nitric acid molecules (HNO3) on the left side to balance it out. This is why you put "2" in front of HNO3. By doing so, you ensure that the number of hydrogen atoms is equal on both sides of the equation, and the equation is balanced.