Question

Расставить коэффициенты: 1: KOH+H3PO4=K2PO4+H2O2: BA(OH)+HNO3=BA(NO)2+H2O3: NA2CO3+HCL=NACL+CO2+H2O4: N2O5+H20=HNO35: AL+H2SO4=H2+AL2(SO4)3

Answer 1

3KOH+H3PO4=K3PO4+3H2O

Ba(OH)2+2HCl=BaCl2+2H2I

Na2CO3+2HCl=2NaCl+CO2+H2O

N2O5+H2O=2HNO3

2Al+3H2SO4=Al2(SO4)3+3H2

Answer 2

To balance chemical equations, we need to ensure that the same number of atoms of each element are present on both sides of the equation. Let's balance the given chemical equations:

1: KOH + H3PO4 = K2PO4 + H2O 2: Ba(OH)2 + HNO3 = Ba(NO3)2 + H2O 3: Na2CO3 + 2HCl = 2NaCl + CO2 + H2O 4: N2O5 + H2O = 2HNO3 5: 2Al + 3H2SO4 = 3H2 + Al2(SO4)3

1: KOH + H3PO4 = K2PO4 + H2O

First, let's balance the hydrogen atoms by adding H2O on the right side: KOH + H3PO4 = K2PO4 + H2O

Next, let's balance the potassium (K) atoms: 2KOH + H3PO4 = K2PO4 + 2H2O

Now, let's balance the oxygen atoms by adding H3PO4 on the left side: 2KOH + H3PO4 = K2PO4 + 2H2O

2: Ba(OH)2 + HNO3 = Ba(NO3)2 + H2O

The equation is already balanced.

3: Na2CO3 + 2HCl = 2NaCl + CO2 + H2O

First, let's balance the hydrogen atoms by adding H2O on the left side: Na2CO3 + 2HCl = 2NaCl + CO2 + H2O

Next, let's balance the sodium (Na) atoms: Na2CO3 + 2HCl = 2NaCl + CO2 + H2O

Now, let's balance the chlorine (Cl) atoms by changing the coefficient of HCl to 2: Na2CO3 + 2HCl = 2NaCl + CO2 + H2O

4: N2O5 + H2O = 2HNO3

First, let's balance the oxygen atoms by adding H2O on the left side: N2O5 + H2O = 2HNO3

Now, let's balance the nitrogen (N) atoms: N2O5 + H2O = 2HNO3

5: 2Al + 3H2SO4 = 3H2 + Al2(SO4)3

The equation is already balanced.

Final balanced equations: 1: 2KOH + H3PO4 = K2PO4 + 2H2O 2: Ba(OH)2 + HNO3 = Ba(NO3)2 + H2O 3: Na2CO3 + 2HCl = 2NaCl + CO2 + H2O 4: N2O5 + H2O = 2HNO3 5: 2Al + 3H2SO4 = 3H2 + Al2(SO4)3