Question

Sr-----SrO-----Sr(OH)2----SrBr2

Answer 1

Ответ:

Объяснение:

С Серой:

1) S + O2 = SO2

2) SO2 + H2O = H2SO3 (реакция обратима)

3) H2SO3 + 2LiOH = Li2SO3 + 2H2O 

Answer 2

The sequence you've provided represents the chemical reactions involving strontium (Sr) and its oxides/hydroxides/bromides. It seems to show the progression of strontium reacting with different elements to form various compounds:

1. Sr: Strontium, an alkaline earth metal (atomic number 38).
2. SrO: Strontium oxide, formed when strontium reacts with oxygen.
3. Sr(OH)2: Strontium hydroxide, formed when strontium oxide reacts with water (hydration).
4. SrBr2: Strontium bromide, formed when strontium reacts with bromine.

The chemical equations for each reaction are as follows:

1. Strontium and Oxygen: 2 Sr + O2 -> 2 SrO

2. Strontium Oxide and Water: SrO + H2O -> Sr(OH)2

3. Strontium and Bromine: Sr + Br2 -> SrBr2

Keep in mind that these reactions may require specific conditions, such as heat or catalysts, to proceed effectively. Additionally, the valency states (oxidation states) of the elements in these compounds are as follows:

• Strontium in Sr: Strontium has a +2 oxidation state in its compounds.
• Oxygen in SrO: Oxygen has a -2 oxidation state in most of its compounds, so it takes two oxygen atoms to balance the charge of one strontium ion.
• Hydrogen in Sr(OH)2: Hydrogen has a +1 oxidation state when bonded to a non-metal like oxygen.
• Bromine in SrBr2: Bromine also has a -1 oxidation state when bonded to metals like strontium.

These reactions demonstrate how elements can combine to form various chemical compounds with different properties and applications.