Question

Клас Самостійна робота по темі «Хімічні рівняння» Ca + O2 → CaO HgO → Hg + O2 Ba + O2 → BaO Na + Br2 → NaBr Fe + Cl2→ FeCl3 N2+ H2 → NH3 Al + C → Al 4 C3 Mg + P → Mg 3 P2 B + O2 → B 2O3 H 2 O → H2 + O2 As + O2 → As 2 O5 K + O2 → K 2 O2 Cu + O2 → CuO H2 + F2 → HF K + Cl2 → KCl Fe + Br2 → FeBr3 Na + H2 → NaH P + O2 → P 2 O5 K + S → K 2S Ag + O2 → Ag 2O Al + I2 → AlI3 C + H2 → CH4 KClO3 → KCl + O2 Ba + HCl → BaCl2 + H2 Li + H 2 O → LiOH + H2 Al +WO3 → W + Al 2 O3 PbO2 + H2 → Pb + H 2 O Ca + HCl → CaCl2 + H2 Al + Cr 2 O3 → Al 2 O3 + Cr SiO2 + HF → SiF4 + H 2O Fe 2 O3 + H2 → Fe + H 2 О Na 2SO4 + BaCl2 → BaSO4 + NaCl Fe 2 O3 + HCl → FeCl3 + H 2О Zn + HCl → ZnCl2 + H2 NaBr + Cl2 → NaCl + Br2

Answer 1

(NH4)+KOH+Cr2O3=KCrO2+H2O

CaCl2+K3PO4=Ca3(PO4)2+KCl

BACl2+Cr2(SO4)3=BaSO4+CrCl3

HK7(Ga+H2O72)=H⁷KB AlWO3 W + Al 2 O3

PbO2 + H2 Pb + H 2 O Ca + HCl CaCl2 + H2

Al + Cr > - 2 O3 Al 2 O(3 + Cr SiO2 + HF >~- SiF4 + H 2O

Fe 2 O3 + H2Fe H 2 О Na 2SO4 + BaCl2) BaSO4- (NaCT)>=H²

Answer 2

Ca + O2 → CaO This is a combination reaction where calcium (Ca) reacts with oxygen (O2) to form calcium oxide (CaO).

HgO → Hg + O2 This is a decomposition reaction where mercury(II) oxide (HgO) decomposes to form mercury (Hg) and oxygen gas (O2).

Ba + O2 → BaO This is a combination reaction where barium (Ba) reacts with oxygen (O2) to form barium oxide (BaO).

NaBr2 → NaBr This is a displacement reaction where sodium (Na) reacts with bromine (Br2) to form sodium bromide (NaBr).

Fe + Cl2 → FeCl3 This is a combination reaction where iron (Fe) reacts with chlorine (Cl2) to form iron(III) chloride (FeCl3).

N2 + H2 → NH3 This is a combination reaction where nitrogen gas (N2) reacts with hydrogen gas (H2) to form ammonia (NH3).

Al + C → Al4C3 This is a combination reaction where aluminum (Al) reacts with carbon (C) to form aluminum carbide (Al4C3).

Mg + P → Mg3P2 This is a combination reaction where magnesium (Mg) reacts with phosphorus (P) to form magnesium phosphide (Mg3P2).

B2O3 + H2O → H2BO3 This is a combination reaction where boron oxide (B2O3) reacts with water (H2O) to form boric acid (H2BO3).

H2 + O2 → H2O This is a combination reaction where hydrogen gas (H2) reacts with oxygen gas (O2) to form water (H2O).

As2 + O2 → As2O5 This is a combination reaction where arsenic (As2) reacts with oxygen gas (O2) to form arsenic pentoxide (As2O5).

K + O2 → K2O This is a combination reaction where potassium (K) reacts with oxygen gas (O2) to form potassium oxide (K2O).

Cu + O2 → CuO This is a combination reaction where copper (Cu) reacts with oxygen gas (O2) to form copper(II) oxide (CuO).

H2 + F2 → HF This is a combination reaction where hydrogen gas (H2) reacts with fluorine gas (F2) to form hydrogen fluoride (HF).

K + Cl2 → KCl This is a combination reaction where potassium (K) reacts with chlorine gas (Cl2) to form potassium chloride (KCl).

Fe + Br2 → FeBr3 This is a combination reaction where iron (Fe) reacts with bromine (Br2) to form iron(III) bromide (FeBr3).

Na + H2 → NaH This is a combination reaction where sodium (Na) reacts with hydrogen gas (H2) to form sodium hydride (NaH).

P + O2 → P2O5 This is a combination reaction where phosphorus (P) reacts with oxygen gas (O2) to form phosphorus pentoxide (P2O5).

K + S → K2S This is a combination reaction where potassium (K) reacts with sulfur (S) to form potassium sulfide (K2S).

Ag + O2 → Ag2O This is a combination reaction where silver (Ag) reacts with oxygen gas (O2) to form silver oxide (Ag2O).

Al + I2 → AlI3 This is a combination reaction where aluminum (Al) reacts with iodine (I2) to form aluminum iodide (AlI3).

C + H2 → CH4 This is a combination reaction where carbon (C) reacts with hydrogen gas (H2) to form methane (CH4).

KClO3 → KCl + O2 This is a decomposition reaction where potassium chlorate (KClO3) decomposes to form potassium chloride (KCl) and oxygen gas (O2).

Ba + HCl → BaCl2 + H2 This is a displacement reaction where barium (Ba) reacts with hydrochloric acid (HCl) to form barium chloride (BaCl2) and hydrogen gas (H2).

Li + H2O → LiOH + H2 This is a displacement reaction where lithium (Li) reacts with water (H2O) to form lithium hydroxide (LiOH) and hydrogen gas (H2).

Al2O3 + H2O → H2AlO3 This is a combination reaction where aluminum oxide (Al2O3) reacts with water (H2O) to form aluminum hydroxide (H2AlO3).

PbO2 + H2 → Pb + H2O This is a displacement reaction where lead dioxide (PbO2) reacts with hydrogen gas (H2) to form lead (Pb) and water (H2O).

Ca + HCl → CaCl2 + H2 This is a displacement reaction where calcium (Ca) reacts with hydrochloric acid (HCl) to form calcium chloride (CaCl2) and hydrogen gas (H2).

Al2O3 + Cr2O3 → Al2O3 + Cr2O3 This is a combination reaction where aluminum oxide (Al2O3) and chromic oxide (Cr2O3) react with each other.

SiO2 + HF → SiF4 + H2O This is a displacement reaction where silicon dioxide (SiO2) reacts with hydrofluoric acid (HF) to form silicon tetrafluoride (SiF4) and water (H2O).

Fe2O3 + H2O → Fe(OH)3 This is a combination reaction where iron(III) oxide (Fe2O3) reacts with water (H2O) to form iron(III) hydroxide (Fe(OH)3).

Na2SO4 + BaCl2 → BaSO4 + 2NaCl This is a double displacement reaction where sodium sulfate (Na2SO4) reacts with barium chloride (BaCl2) to form barium sulfate (BaSO4) and sodium chloride (NaCl).

Fe2O3 + HCl → FeCl3 + H2O This is a displacement reaction where iron(III) oxide (Fe2O3) reacts with hydrochloric acid (HCl) to form iron(III) chloride (FeCl3) and water (H2O).

Zn + HCl → ZnCl2 + H2 This is a displacement reaction where zinc (Zn) reacts with hydrochloric acid (HCl) to form zinc chloride (ZnCl2) and hydrogen gas (H2).

NaBr + Cl2 → NaCl + Br2 This is a displacement reaction where sodium bromide (NaBr) reacts with chlorine gas (Cl2) to form sodium chloride (NaCl) and bromine gas (Br2).