Question

Ba(OH)2+H3PO4=HNO3+Ca(OH)2=Решить​

Answer 1

Ba(OH)2+2H3PO4=Ba(H2PO4)2+2H2O

2HNO3+Ca(OH)2=Ca(NO3)2+H2O

Answer 2

To solve this chemical equation, we need to balance it first. The given equation is:

Ba(OH)2 + H3PO4 = HNO3 + Ca(OH)2

Step 1: Balance the barium (Ba) atoms: There is 1 Ba atom on the left side and 1 Ca atom on the right side. To balance this, we can put a coefficient of 1 in front of Ca(OH)2:

Ba(OH)2 + H3PO4 = HNO3 + Ca(OH)2

Step 2: Balance the hydrogen (H) atoms: There are 2 hydrogen atoms in Ba(OH)2 and 3 hydrogen atoms in H3PO4 on the left side. On the right side, there are 1 hydrogen atom in HNO3 and 2 hydrogen atoms in Ca(OH)2. To balance this, we can put a coefficient of 3 in front of HNO3 and a coefficient of 2 in front of Ca(OH)2:

Ba(OH)2 + H3PO4 = 3 HNO3 + 2 Ca(OH)2

Step 3: Balance the oxygen (O) atoms: There are 2 oxygen atoms in Ba(OH)2, 4 oxygen atoms in H3PO4, and 6 oxygen atoms in Ca(OH)2 on the left side. On the right side, there are 9 oxygen atoms in HNO3. To balance this, we can put a coefficient of 9/2 (4.5) in front of HNO3:

Ba(OH)2 + H3PO4 = 4.5 HNO3 + 2 Ca(OH)2

However, we can't have fractional coefficients in a balanced chemical equation. To remove the fractional coefficient, we can multiply the entire equation by 2:

2 Ba(OH)2 + 2 H3PO4 = 9 HNO3 + 4 Ca(OH)2

Now, the equation is balanced. The balanced equation is:

2 Ba(OH)2 + 2 H3PO4 = 9 HNO3 + 4 Ca(OH)2