Question

Na2O ---> NaOH ---> Na3PO4 Ca ---> Ca(OH)2 ---> Ca(Mo3)2 Mg ---> MgO ---> MgCl2 Fe2O3 ---> Fe2(SO4)3 ---> Fe(OH)3 ---> Fe2O3 ---> Fe ---> FeCl2

Answer 1

Na2O+H2O=2NaOH. 6NaOH+P2O5=2Na3PO4+3H2O

Ca+2H2O=Ca(OH)2+H2. Ca(OH)2+Cu(NO3)2=Ca(NO3)2+Cu(OH)2

2Mg+O2=2MgO. MgO+2HCl=MgCl2+H2O

Fe2O3+3H2SO4=Fe2(SO4)3+3H2O. Fe2(SO4)3+6NaOH=3Na2SO4+2Fe(OH)3.

2Fe(OH)3=Fe2O3+3H2O. Fe2O3+3H2=2Fe+3H2O. Fe+Cl2=FeCl2

Answer 2

It seems like you've provided a series of chemical reactions involving different elements and compounds. However, there are a few errors and inconsistencies in your statements. Let's go through each one:

1. Na2O --> NaOH --> Na3PO4:

   • The reaction from Na2O to NaOH involves the addition of water (H2O), not a direct transformation.
   • The reaction from NaOH to Na3PO4 involves phosphoric acid (H3PO4) rather than a simple transformation. The balanced equation would be: 6 NaOH + H3PO4 -> 2 Na3PO4 + 3 H2O

2. Ca --> Ca(OH)2 --> Ca(Mo3)2:

   • The reaction from Ca to Ca(OH)2 involves the addition of water and is correctly written.
   • The compound "Ca(Mo3)2" is not a valid chemical compound. If you meant something else, please provide more information.

3. Mg --> MgO --> MgCl2:

   • The reaction from Mg to MgO involves the oxidation of magnesium, not a direct transformation.
   • The reaction from MgO to MgCl2 would involve the reaction with hydrochloric acid (HCl). The balanced equation would be: MgO + 2 HCl -> MgCl2 + H2O

4. Fe2O3 --> Fe2(SO4)3 --> Fe(OH)3 --> Fe2O3 --> Fe --> FeCl2:

   • The reaction from Fe2O3 to Fe2(SO4)3 involves the reaction with sulfuric acid (H2SO4), not a simple transformation.
   • The reaction from Fe2(SO4)3 to Fe(OH)3 involves the addition of water and a base (NaOH or KOH), rather than a direct transformation.
   • The reaction from Fe(OH)3 back to Fe2O3 is not a common reaction.
   • The reaction from Fe2O3 to Fe involves the reduction of iron oxide, typically achieved through a complex process involving carbon (as in a blast furnace) or other reducing agents.
   • The reaction from Fe to FeCl2 would involve the reaction with hydrochloric acid (HCl). The balanced equation would be: Fe + 2 HCl -> FeCl2 + H2

Please clarify your intentions or provide more details if you have specific reactions in mind. Also, keep in mind that chemical reactions often involve specific conditions and reagents to occur.