Question

1) Fe(OH2)+HJ=2) Li OH+SO2=3) Na OH+Fe(SO4)3=4) KOH=​

Answer 1

Объяснение:

1) Fe(OH)2+2HJ=FeJ2+2H2O

2) 2Li OH+SO2=Li2SO3+H2O

3) 3Na OH+Fe(SO4)3=3Na2SO4+Fe(OH)3

4) 2KOH=K2O +H2O (но реакция почти сразу будет идти в обратном направлении)

Answer 2

It seems like you've written chemical reactions in a somewhat unusual format, and some of the reactions you've provided are incomplete or unclear. Let me try to interpret and balance them for you:

1. Fe(OH)2 + HCl → This reaction involves iron(II) hydroxide and hydrochloric acid. To balance it, you would need:

Fe(OH)2 + 2HCl → FeCl2 + 2H2O

2. LiOH + SO2 → It appears you want to react lithium hydroxide with sulfur dioxide. The balanced reaction would be:

2LiOH + SO2 → Li2SO3 + H2O

3. NaOH + Fe(SO4)3 → This reaction involves sodium hydroxide and iron(III) sulfate. The balanced reaction would be:

6NaOH + Fe2(SO4)3 → 3Fe(OH)3 + 6Na2SO4

4. KOH → This is a dissociation reaction of potassium hydroxide, so it doesn't need balancing:

KOH → K+ + OH-

Please note that in chemical reactions, it's important to provide the correct formulas for the substances involved, and you should specify the states of matter (solid, liquid, gas, or aqueous) for each substance when needed for a complete description of the reaction.