Question

P2O5+....=Ca3(PO4)2+H2OMg+....=MgCl2+H2MgO+...=MgSO4 ​

Answer 1

Ответ:

P2O5+3Ca(OH)2=Ca3(PO4)2+H2O
Mg+2HCl=MgCl2+H2
MgO+SO3=MgSO4

Answer 2

To balance the chemical equations you provided, we need to determine the coefficients for each compound so that the number of atoms is balanced on both sides of the equation. Let's go through each equation step by step:

1. P2O5 + ? = Ca3(PO4)2 + H2O

To balance the equation, we need to determine the coefficient for H2O. Let's start by balancing the phosphorus (P) atoms:

On the left side, we have 2 phosphorus atoms (P2O5), and on the right side, we have 2 phosphorus atoms (Ca3(PO4)2). This means the phosphorus atoms are already balanced.

Now, let's balance the oxygen (O) atoms:

On the left side, we have 5 oxygen atoms (P2O5), and on the right side, we have 10 oxygen atoms (Ca3(PO4)2 + H2O). To balance the oxygen atoms, we need to add a coefficient of 5 in front of H2O:

P2O5 + 5H2O = Ca3(PO4)2 + H2O

Now, let's simplify the equation:

P2O5 + 4H2O = Ca3(PO4)2

Therefore, the balanced equation is:

P2O5 + 4H2O = Ca3(PO4)2

2. Mg + ? = MgCl2 + H2

To balance this equation, we need to determine the coefficient for H2. First, let's balance the magnesium (Mg) atoms:

On the left side, we have 1 magnesium atom (Mg), and on the right side, we have 1 magnesium atom (MgCl2). This means the magnesium atoms are already balanced.

Now, let's balance the chlorine (Cl) atoms:

On the right side, we have 2 chlorine atoms (MgCl2). To balance the chlorine atoms, we need to add a coefficient of 2 in front of Mg:

Mg + ? = 2MgCl2 + H2

Now, let's balance the hydrogen (H) atoms:

On the right side, we have 2 hydrogen atoms (H2). To balance the hydrogen atoms, we need to add a coefficient of 2 in front of H2:

Mg + ? = 2MgCl2 + 2H2

Therefore, the balanced equation is:

Mg + 2HCl = MgCl2 + H2

3. MgO + ? = MgSO4

To balance this equation, we need to determine the coefficient for MgO. Let's start by balancing the magnesium (Mg) atoms:

On the left side, we have 1 magnesium atom (MgO), and on the right side, we have 1 magnesium atom (MgSO4). This means the magnesium atoms are already balanced.

Now, let's balance the sulfur (S) atoms:

On the right side, we have 1 sulfur atom (MgSO4). To balance the sulfur atoms, we need to add a coefficient of 1 in front of MgO:

MgO + ? = MgSO4

Now, let's balance the oxygen (O) atoms:

On the left side, we have 1 oxygen atom (MgO), and on the right side, we have 4 oxygen atoms (MgSO4). To balance the oxygen atoms, we need to add a coefficient of 4 in front of MgO:

4MgO + ? = MgSO4

Therefore, the balanced equation is:

4MgO + MgSO4 = 5M