Question

HCl+Ba(OH)2=BACl2+H2O Ca+H2O=Ca(OH)2=Ca(OH)2+H2 CA+N2=Ca3N2 NaNo3=NaNO2+O2 расставить коэффициенты,определить тип реакции

Answer 1

1) HCL+BA(OH)2=BA(CL2)2+H20 РЕАКЦИЯ ОБМЕНА
2 CA+H2O=CA(OH2)2+H2 РЕАКЦИЯ ЗАМЕЩЕНИЯ
3) CA+N2=CA3N2 здесь нет ошибки?? ТИП РЕАКЦИИ: СОЕДИНЕНИЕ
4) NaNO3=NANO2+O2  РЕАКЦИЯ РАЗЛОЖЕНИЯ
 

Answer 2

Balancing the Chemical Equations

Let's balance the given chemical equations step by step:

1. HCl + Ba(OH)2 = BaCl2 + H2O

To balance this equation, we need to ensure that the number of atoms of each element is the same on both sides of the equation.

The balanced equation is: 2HCl + Ba(OH)2 = BaCl2 + 2H2O.

2. Ca + H2O = Ca(OH)2

The balanced equation is: Ca + 2H2O = Ca(OH)2 + H2.

3. Ca + H2O + Ca + N2 = Ca3N2

The balanced equation is: 3Ca + N2 + 3H2O = Ca3N2 + 3H2.

4. NaNO3 = NaNO2 + O2

The balanced equation is: 2NaNO3 = 2NaNO2 + O2.

Types of Reactions

1. HCl + Ba(OH)2 = BaCl2 + H2O

This is a double displacement reaction or a neutralization reaction. In this reaction, the hydrogen ions (H+) from hydrochloric acid (HCl) react with the hydroxide ions (OH-) from barium hydroxide (Ba(OH)2) to form water (H2O). The barium ions (Ba2+) from barium hydroxide react with the chloride ions (Cl-) from hydrochloric acid to form barium chloride (BaCl2).

2. Ca + H2O = Ca(OH)2

This is a single displacement reaction. In this reaction, calcium (Ca) reacts with water (H2O) to form calcium hydroxide (Ca(OH)2) and hydrogen gas (H2).

3. Ca + H2O + Ca + N2 = Ca3N2

This is a combination reaction. In this reaction, calcium (Ca) reacts with water (H2O) and nitrogen gas (N2) to form calcium nitride (Ca3N2).

4. NaNO3 = NaNO2 + O2

This is a decomposition reaction. In this reaction, sodium nitrate (NaNO3) decomposes to form sodium nitrite (NaNO2) and oxygen gas (O2).

I hope this helps! Let me know if you have any further questions.