Question

P=P2O5=Ba3(PO4)2=H3PO4=NaH2PO4=Na2HPO4

Answer 1

4P+5O2 --- 2P2O5
P2O5 + 3Ba(OH) 2 --- Ba3(PO4)2 + 3H2O
Ba3(PO4)2 + 3HSO4 --- 2BaSO4 + 3H3PO4
H3PO4 + NaOH -- NaH2PO4 + H20
NaH2PO4 + NaOH -- Na2HPO4+H20

Answer 2

4P + 5O2 = 2P2O5

P2O5 + 3BaO = Ba3(PO4)2

Ba3(PO4)2 + 6HCl = 3BaCl2 + 2H3PO4

2H3PO4 + 2Na = 2NaH2PO4 + H2

2NaH2PO4 + 2Na = 2Na2HPO4 + H2

Answer 3

It seems like you've listed a series of chemical formulas related to phosphorus (P) and its compounds. Let me break down what each of these formulas represents:

1. P: This represents elemental phosphorus, which is a chemical element with the symbol P.

2. P2O5: This is the chemical formula for diphosphorus pentoxide, a covalent compound that consists of two phosphorus atoms and five oxygen atoms. It is a common reagent in chemical reactions and can be used as a dehydrating agent.

3. Ba3(PO4)2: This is the chemical formula for barium phosphate. It consists of three barium (Ba) ions and two phosphate (PO4) ions. Barium phosphate is an ionic compound.

4. H3PO4: This is the chemical formula for phosphoric acid, a mineral acid. It contains three hydrogen (H) atoms, one phosphorus atom (P), and four oxygen atoms (O). It is used in various industrial and laboratory applications.

5. NaH2PO4: This is the chemical formula for sodium dihydrogen phosphate. It contains one sodium (Na) ion, two hydrogen ions (H), one phosphorus atom (P), and four oxygen atoms (O). It is often used as a buffer solution in chemical and biological experiments.

6. Na2HPO4: This is the chemical formula for disodium hydrogen phosphate, which contains two sodium ions (Na), one hydrogen ion (H), one phosphorus atom (P), and four oxygen atoms (O). It is also used in buffer solutions and various chemical applications.

These chemical formulas represent different phosphorus-containing compounds with varying properties and uses in chemistry and industry. If you have any specific questions about these compounds or their applications, feel free to ask!