Question

Cr-cr2o3-cr2(so4)3-cr(oh)3

Answer 1

2Cr + 3H2O= Cr2O3 + 3H2
Cr2O3 + 3K2S2O7 = Cr2(SO4)3 + 3K2SO4
Cr2(SO4)3 + 6NaOH = 2Cr(OH)3 + 3Na2SO4

Answer 2

Chemical Reactions: Cr-Cr2O3-Cr2(SO4)3-Cr(OH)3

The chemical reactions involving Cr, Cr2O3, Cr2(SO4)3, and Cr(OH)3 can be summarized as follows:

1. Cr to Cr2O3: - The reaction is as follows: 2 Cr + 3 O2 → 2 Cr2O3 [[5]](https://uchi.ru/otvety/questions/1-cr-cr2o3-cr2-so4-3-cr-oh-3-h2cro4-2-cr-oh-3-kcro2-k2cr2o7). - This reaction represents the oxidation of chromium (Cr) to chromium(III) oxide (Cr2O3).

2. Cr2O3 to Cr2(SO4)3: - The reaction is as follows: 3 Cr2O3 + 6 H2SO4 → 2 Cr2(SO4)3 + 3 H2O. - This reaction involves the reaction of chromium(III) oxide (Cr2O3) with sulfuric acid (H2SO4) to form chromium(III) sulfate (Cr2(SO4)3) and water (H2O).

3. Cr2(SO4)3 to Cr(OH)3: - The reaction is as follows: Cr2(SO4)3 + 6 NaOH → 2 Cr(OH)3 + 3 Na2SO4 [[6]](https://uchi.ru/otvety/questions/1-cr-gt-cr2o3-gt-cr2-so4-3-gt-cr-oh-3-gt-h2cro4-2-cr-oh-3-gt-kcro2-gt-k2cr2o7). - This reaction involves the reaction of chromium(III) sulfate (Cr2(SO4)3) with sodium hydroxide (NaOH) to form chromium(III) hydroxide (Cr(OH)3) and sodium sulfate (Na2SO4).

4. Cr(OH)3 to H2CrO4: - The reaction is as follows: 2 Cr(OH)3 + 3 H2O2 → 2 H2CrO4 + 4 H2O [[6]](https://uchi.ru/otvety/questions/1-cr-gt-cr2o3-gt-cr2-so4-3-gt-cr-oh-3-gt-h2cro4-2-cr-oh-3-gt-kcro2-gt-k2cr2o7). - This reaction involves the reaction of chromium(III) hydroxide (Cr(OH)3) with hydrogen peroxide (H2O2) to form chromic acid (H2CrO4) and water (H2O).

Please note that these reactions are simplified representations and may not account for all possible reaction conditions or intermediates.