Question

Cu-CuSo4-Cu(OH)2-Cu (NO3)2-NO2

Answer 1

This 
2Cu+O2=2CuO 
CuO+H2SO4=CuSO4+H2O 
CuSO4+2KOH=Cu(OH)2+K2SO4 
Cu(OH)2+HNO3(нехватка к-ты) =CuOHNO3+H2O 
CuOHNO3+HNO3=Cu(NO3)2+H2O

Answer 2

The sequence of reactions you provided involves the chemical transformations of copper (Cu) with various compounds. Let's break down each step:

1. Cu + CuSO4 → Cu + CuSO4 This is not a chemical reaction. It simply shows copper (Cu) reacting with copper sulfate (CuSO4), resulting in copper and unchanged copper sulfate.

2. CuSO4 + Cu(OH)2 → Cu + CuSO4 + H2O This is also not a balanced chemical reaction. It appears to show copper sulfate (CuSO4) reacting with copper hydroxide (Cu(OH)2), resulting in copper, unchanged copper sulfate, and water (H2O). However, the reaction is not balanced.

3. Cu(OH)2 + Cu(NO3)2 → Cu + Cu(OH)2 + NO3 Similar to the previous reactions, this equation is unbalanced and doesn't represent a proper chemical reaction. It seems to show copper hydroxide (Cu(OH)2) reacting with copper nitrate (Cu(NO3)2), producing copper, unchanged copper hydroxide, and nitrate ions (NO3). Again, the reaction needs to be balanced.

4. Cu(NO3)2 + NO2 → Cu + NO2 + O2 This equation shows copper nitrate (Cu(NO3)2) reacting with nitrogen dioxide (NO2), yielding copper, nitrogen dioxide, and oxygen gas (O2). However, this reaction is also not balanced.

To better understand the reactions and write balanced equations, I'll need more context or information about the conditions of the reactions, such as temperature, pressure, and any other reactants or catalysts involved. Additionally, some of the reactions provided might be incomplete or incorrect, as they don't seem to follow the rules of chemical reactions. Please provide more details or clarify the reactions you would like to explore.