Question

3 єтил гексан формула

Answer 1

CH3-CH2-CH-CH2-CH2-CH3

                   |

               C2H5

Вот, прямые-это связи. Цифры пиши как индекс внизу.

Answer 2

It seems there might be a slight error in the way you've written the chemical name. I assume you meant "3-ethylhexane." If so, the chemical formula for 3-ethylhexane is C8H18.

This molecule is an alkane with eight carbon atoms (C8) and 18 hydrogen atoms (H18). The "3-ethyl" part of the name indicates that there is an ethyl group (C2H5) attached to the third carbon atom of the hexane chain (C6H14). The complete structure can be represented as:

CH3-CH2-CH(CH3)-CH2-CH2-CH2-CH3

Each "CH2" represents a methylene group (-CH2-), and "CH3" represents a methyl group (-CH3). The "3-ethyl" group is attached to the third carbon atom (counting from either end of the chain), leading to the name "3-ethylhexane."