Question

Ni(oh)2-nio-niso4-ni(oh)2​

Answer 1

Ni(OH)2 -> NiO + H2O

NiO + H2SO4 -> NiSO4 + H2O

NiSO4 + 2NaOH -> Na2SO4 + Ni(OH)2(зеленый осадок)

Answer 2

The given chemical formula is Ni(OH)2-NiO-NiSO4-Ni(OH)2. This formula represents a sequence of compounds involving nickel (Ni) and sulfur (S) elements.

1. Ni(OH)2: This compound is nickel(II) hydroxide. It consists of a nickel ion (Ni2+) bonded to two hydroxide ions (OH-) forming a solid precipitate.

2. NiO: This compound is nickel(II) oxide. It is an inorganic compound in which a nickel ion (Ni2+) is bonded to an oxygen ion (O2-). It is commonly referred to as nickel oxide.

3. NiSO4: This compound is nickel(II) sulfate. It consists of a nickel ion (Ni2+) bonded to a sulfate ion (SO42-). It is a blue-green solid compound often used in electroplating and as a catalyst.

4. Ni(OH)2: This compound, as mentioned earlier, is nickel(II) hydroxide. It has the same chemical structure as the first compound in the sequence.

Overall, the formula Ni(OH)2-NiO-NiSO4-Ni(OH)2 represents a series of compounds involving nickel and sulfur, specifically nickel(II) hydroxide, nickel(II) oxide, nickel(II) sulfate, and nickel(II) hydroxide.