Question

1) CH3-CHOH-CH(C2H5)-CH3; 2) CH2OH-CH2-CHOH-CH3; 3) CH3-C(CH3)2- CH(CH3)-CH2-COH

Answer 1

Ответ:

1) 3-этилбутанол-2

2) бутандиол-1,3

3) 3,4,4-триметилпентанол-1

Answer 2

It looks like you've provided three chemical structures. Let me provide you with the names of the compounds corresponding to these structures:

1. CH3-CHOH-CH(C2H5)-CH3: This is 2-ethylbutanol.

2. CH2OH-CH2-CHOH-CH3: This is 2-methyl-2-propanol, also known as tert-butyl alcohol.

3. CH3-C(CH3)2-CH(CH3)-CH2-COH: This is 2,2-dimethylpropanoic acid, also known as neopentanoic acid.

If you have any more questions or need further clarification, please let me know!