Question

CuSO4>Cu>CuO>CuCI2>Cu(OH)2>Cu(NO3)2​

Answer 1

Объяснение:

CuSO4+Fe=FeSO4+Cu

2Cu+O2=2CuO

CuO+2HCl=CuCl2+H2O

CuCl2+2NaOH=Cu(OH)2+2NaCl

Cu(OH)2+2HNO3=Cu(NO3)2+2H2O

Answer 2

The expression you provided seems to be a comparison of various copper compounds, indicating a hypothetical order in which they may be arranged based on some criteria. It appears to represent a sequence from least reactive or least soluble to most reactive or most soluble forms of copper compounds in an aqueous solution, possibly in terms of their solubility or reactivity.

Here's a brief explanation of each compound in the order you listed:

1. CuSO4 (Copper(II) sulfate): Copper sulfate is a soluble salt, and it dissociates in water to form copper ions (Cu²⁺) and sulfate ions (SO₄²⁻).

2. Cu (Copper metal): Solid copper metal does not readily dissolve in water. It's less soluble than copper salts.

3. CuO (Copper(II) oxide): Copper oxide is less soluble than copper sulfate and copper chloride. It is an insoluble compound, which means it has low solubility in water.

4. CuCl2 (Copper(II) chloride): Copper chloride is a soluble salt, and it dissociates in water to form copper ions (Cu²⁺) and chloride ions (Cl⁻).

5. Cu(OH)2 (Copper(II) hydroxide): Copper hydroxide is relatively insoluble in water. It can form a precipitate when copper ions react with hydroxide ions.

6. Cu(NO3)2 (Copper(II) nitrate): Copper nitrate is a soluble salt, similar to copper sulfate and copper chloride. It dissociates in water to form copper ions (Cu²⁺) and nitrate ions (NO₃⁻).

This order is a simplification and generalization, as the solubility and reactivity of these compounds can vary depending on various factors, including temperature and concentration. Additionally, the order may change if other criteria are considered, such as reactivity in chemical reactions or the formation of complexes with other ligands.

If you have a specific question or need more information about a particular aspect of these compounds, please feel free to ask.