Вопрос задан 03.09.2020 в 07:12. Предмет Химия. Спрашивает Martirosyan Ab.

Нужно формулы 3 изомеров разного вида и 2 гомологов нонанола(назвать изомеры)

0 0
Перейти к ответам

Ответы на вопрос

Внимание! Ответы на вопросы дают живые люди. Они могут содержать ошибочную информацию, заблуждения, а также ответы могут быть сгенерированы нейросетями. Будьте внимательны. Если вы уверены, что ответ неверный, нажмите кнопку "Пожаловаться" под ответом.
Отвечает нейросеть ChatGpt. Будьте внимательны, ответы нейросети могут содержать ошибочные или выдуманные данные.

Isomers of Nonanol:

Nonanol is a nine-carbon alcohol with the molecular formula C9H20O. It can exist in different structural forms known as isomers. Isomers have the same molecular formula but differ in the arrangement of atoms within the molecule. Here are three different isomers of nonanol:

1. 1-Nonanol: This isomer has a linear chain of nine carbon atoms with the hydroxyl group (-OH) attached to the first carbon atom. The structural formula for 1-nonanol is:

``` CH3(CH2)7OH ```

2. 2-Nonanol: In this isomer, the hydroxyl group is attached to the second carbon atom in the linear chain. The structural formula for 2-nonanol is:

``` CH3CH2(CH2)6OH ```

3. 3-Nonanol: This isomer has the hydroxyl group attached to the third carbon atom in the linear chain. The structural formula for 3-nonanol is:

``` CH3(CH2)2CH(OH)CH2(CH2)3CH3 ```

Homologs of Nonanol:

Homologs are compounds that belong to the same chemical series and have similar chemical properties but differ by a constant increment in molecular structure. Here are two homologs of nonanol:

1. Octanol: Octanol is a homolog of nonanol with eight carbon atoms in its chain. The structural formula for octanol is:

``` CH3(CH2)6OH ```

2. Decanol: Decanol is another homolog of nonanol with ten carbon atoms in its chain. The structural formula for decanol is:

``` CH3(CH2)8OH ```

Please note that the structural formulas provided here are simplified representations of the isomers and homologs of nonanol. The actual structures may have different conformations and arrangements of atoms in three-dimensional space.

0 0

Топ вопросов за вчера в категории Химия

Последние заданные вопросы в категории Химия

Задать вопрос