Question

Закінчити рівняння реакцій:1. Ca + CO2. Ba

Answer 1

Ca(NO3)2 + Na2CO3 = CaCO3↓ + 2NaNO3

BaCl2 + K2SO4 = BaSO4↓ + 2KCl

NaOH + HCl = NaCl + H2O

Answer 2

CaCl2+Na2CO3=CaCO3+2NaCl


Ba(NO3)3+H2SO4=BaSO4+2HNO3

LiOH+HNO3=LiNO3+H2O

Answer 3

1. Ca + CO2 -> CaCO3

This equation represents the reaction between calcium (Ca) and carbon dioxide (CO2), resulting in the formation of calcium carbonate (CaCO3).

When calcium reacts with carbon dioxide, the calcium atom loses two electrons, becoming Ca2+. The carbon dioxide molecule (CO2) consists of one carbon atom bonded to two oxygen atoms. During the reaction, the carbon atom in CO2 gains two electrons from the calcium atom, forming a carbonate ion (CO3^2-).

The final product of the reaction is calcium carbonate (CaCO3), which is a white, solid compound. It is commonly found in nature as limestone, marble, and chalk. Calcium carbonate is also used in various industries, including construction, agriculture, and pharmaceuticals.