Question

Составьте пары соответствияNa+S=Na2S n(A):n(B):n(C):n(D)=2:1:1:2Na2O+H2O=NaOH n(A):n(B):n(C):n(D)=2:2:2:1Na+H2O=NaOh+H2 n(A):n(B):n(C)=1:1:2Na+O2=Na2O n(A):n(B):n(C)=4:1:2NaOh+H2SO4=Na2SO4+H2O n(A):n(B):n(C)=2:1:1

Answer 1

1. 5)
2. 3)
3. 2)
4. 4)
5. 1)

Answer 2

Первое соответствие: Na + S = Na2S В данном случае соединение натрия (Na) соединяется с серой (S) для образования сульф

Answer 3

Pairs of Correspondence:

1. Na + S = Na2S - The ratio of atoms in the reaction is 2:1, meaning that for every 2 atoms of sodium (Na), there is 1 atom of sulfur (S) in the compound sodium sulfide (Na2S).

2. Na2O + H2O = NaOH - The ratio of molecules in the reaction is 2:2, meaning that for every 2 molecules of sodium oxide (Na2O), there are 2 molecules of water (H2O) in the compound sodium hydroxide (NaOH).

3. Na + H2O = NaOH + H2 - The ratio of atoms in the reaction is 1:1, meaning that for every 1 atom of sodium (Na), there is 1 atom of hydrogen (H) in the compound sodium hydroxide (NaOH), and 1 molecule of hydrogen gas (H2) is produced.

4. Na + O2 = Na2O - The ratio of atoms in the reaction is 4:1, meaning that for every 4 atoms of sodium (Na), there is 1 molecule of oxygen (O2) in the compound sodium oxide (Na2O).

5. NaOH + H2SO4 = Na2SO4 + H2O - The ratio of molecules in the reaction is 2:1:1, meaning that for every 2 molecules of sodium hydroxide (NaOH) and 1 molecule of sulfuric acid (H2SO4), there is 1 molecule of sodium sulfate (Na2SO4) and 1 molecule of water (H2O) produced.

Please let me know if there's anything else I can help you with!