Question

NaOH+HCl=...CuO+H2SO4=...K2O+H2O=...BaCl2+AgNO3=...Mg+HCl=...Fe2O3+HNO3=...SO3+H2O=...BaCl2+NaSO4=...Cu(OH)2=HCl=...BaO+H2SO4=...CaO+H2O=...Fe(OH)3+HCl=...K2O+CO2=...?????помогите пожалуйста!

Answer 1

NaOH+HCl=.NaCl+H2O
CuO+H2SO4=CuSO4+H2O
K2O+H2O=2.KOH
BaCl2+2AgNO3=2AgCl+Ba(NO3)2
Mg+2HCl=MgCl2+H2
Fe2O3+6HNO3=2Fe(NO3)3+3H2O
SO3+H2O=H2SO4
BaCl2+Na2SO4= 2NaCl+BaSO4
Cu(OH)2+2HCl=2H2O+CuCl2
BaO+H2SO4=BaSO4+H2O
CaO+H2O=Ca(OH)2
Fe(OH)3+3HCl= FeCl3+3H2O
K2O+CO2=K2CO3

Answer 2

NaCl+H2O
СuSO4 +H2O 
2KOH  
Ba(No3)2 + 2AgCl(осадок)
MgCl2 + H2 
2Fe(NO3)3 + 3H2O 
2SO3 
BaSO4 + 2 NaCl 
СuCl2 + H2O
BaSO4+Н2О  
Са(ОН)2 
FeCl3 + 3H2O
K2CO3

Answer 3

NaOH + HCl = ...

The reaction between sodium hydroxide (NaOH) and hydrochloric acid (HCl) results in the formation of sodium chloride (NaCl) and water (H2O).

The balanced chemical equation for this reaction is:

2NaOH + HCl → 2NaCl + 2H2O

CuO + H2SO4 = ...

When copper(II) oxide (CuO) reacts with sulfuric acid (H2SO4), copper(II) sulfate (CuSO4) and water (H2O) are formed.

The balanced chemical equation for this reaction is:

CuO + H2SO4 → CuSO4 + H2O

K2O + H2O = ...

Potassium oxide (K2O) reacts with water (H2O) to form potassium hydroxide (KOH).

The balanced chemical equation for this reaction is:

K2O + H2O → 2KOH

BaCl2 + AgNO3 = ...

When barium chloride (BaCl2) reacts with silver nitrate (AgNO3), barium nitrate (Ba(NO3)2) and silver chloride (AgCl) are formed.

The balanced chemical equation for this reaction is:

BaCl2 + 2AgNO3 → 2AgCl + Ba(NO3)2

Mg + HCl = ...

Magnesium (Mg) reacts with hydrochloric acid (HCl) to produce magnesium chloride (MgCl2) and hydrogen gas (H2).

The balanced chemical equation for this reaction is:

Mg + 2HCl → MgCl2 + H2

Fe2O3 + HNO3 = ...

When iron(III) oxide (Fe2O3) reacts with nitric acid (HNO3), iron(III) nitrate (Fe(NO3)3) and water (H2O) are formed.

The balanced chemical equation for this reaction is:

Fe2O3 + 6HNO3 → 2Fe(NO3)3 + 3H2O

SO3 + H2O = ...

Sulfur trioxide (SO3) reacts with water (H2O) to form sulfuric acid (H2SO4).

The balanced chemical equation for this reaction is:

SO3 + H2O → H2SO4

BaCl2 + NaSO4 = ...

When barium chloride (BaCl2) reacts with sodium sulfate (Na2SO4), barium sulfate (BaSO4) and sodium chloride (NaCl) are formed.

The balanced chemical equation for this reaction is:

BaCl2 + Na2SO4 → BaSO4 + 2NaCl

Cu(OH)2 = HCl = ...

Copper(II) hydroxide (Cu(OH)2) reacts with hydrochloric acid (HCl) to form copper(II) chloride (CuCl2) and water (H2O).

The balanced chemical equation for this reaction is:

Cu(OH)2 + 2HCl → CuCl2 + 2H2O

BaO + H2SO4 = ...

When barium oxide (BaO) reacts with sulfuric acid (H2SO4), barium sulfate (BaSO4) is formed.

The balanced chemical equation for this reaction is:

BaO + H2SO4 → BaSO4 + H2O

CaO + H2O = ...

Calcium oxide (CaO), also known as quicklime, reacts with water (H2O) to form calcium hydroxide (Ca(OH)2).

The balanced chemical equation for this reaction is:

CaO + H2O → Ca(OH)2

Fe(OH)3 + HCl = ...

Iron(III) hydroxide (Fe(OH)3) reacts with hydrochloric acid (HCl) to form iron(III) chloride (FeCl3) and water (H2O).

The balanced chemical equation for this reaction is:

Fe(OH)3 + 3HCl → FeCl3 + 3H2O

K2O + CO2 = ...

Potassium oxide (K2O) does not directly react with carbon dioxide (CO2) under normal conditions. However, if heated to high temperatures, it can react with carbon dioxide to form potassium carbonate (K2CO3).

The balanced chemical equation for this reaction is:

K2O + CO2 → K2CO3

Please note that the reactions mentioned above are simplified representations and may not take into account specific reaction conditions or other factors that may influence the reaction outcomes.