Question

Nh3 n2 no no2 hno3 nh4no3 nh3 (nh4)2so4 Помогите!

Answer 1

NH3=N2=NO=NO2=HNO3=NH4NO3=NH3=(NH4)2SO4
2NH3=N2+3H2
N2+O2=2NO
2NO+O2=2NO2
2NO2+H2O=HNO3+HNO2
2HNO3+4H2=NH4NO3+3H2O
NH4NO3+8H2=2NH3+3H2O
H2SO4+2NH3•H2O=(NH4)2SO4+2H2O

Answer 2

Chemical Reactions and Compounds

Let's break down the chemical reactions and compounds you mentioned:

1. NH3: NH3 is the chemical formula for ammonia, a colorless gas with a pungent smell. It is commonly used in cleaning products, fertilizers, and industrial processes.

2. N2: N2 represents nitrogen gas, which makes up about 78% of Earth's atmosphere. Nitrogen gas is relatively inert and is used in various industrial processes, such as in the production of ammonia and fertilizers.

3. NO: NO is the chemical formula for nitric oxide, a colorless gas with a sharp odor. Nitric oxide is involved in various physiological processes in the human body and is also used in industrial applications, such as in the production of nitric acid.

4. NO2: NO2 represents nitrogen dioxide, a reddish-brown gas with a pungent odor. It is a highly reactive compound and is a major contributor to air pollution. Nitrogen dioxide is produced from the oxidation of nitric oxide and is involved in the formation of smog and acid rain.

5. HNO3: HNO3 is the chemical formula for nitric acid, a strong acid commonly used in the production of fertilizers, explosives, and various organic compounds. Nitric acid is highly corrosive and can cause severe burns.

6. NH4NO3: NH4NO3 is the chemical formula for ammonium nitrate, a white crystalline solid commonly used as a fertilizer and explosive. It is highly soluble in water and releases nitrogen gas when heated or subjected to a shock.

7. NH3 + (NH4)2SO4: The reaction between ammonia (NH3) and ammonium sulfate ((NH4)2SO4) produces ammonium bisulfate (NH4HSO4) and ammonium sulfite ((NH4)2SO3).

Please let me know if you have any specific questions about these compounds or reactions!