Question

Ca(OH)2+NaOH---> Ca(OH)2+P2O3---> Fe--->FeSO4--->Fe(OH)2--->FeO--->Fe(NO3)2

Answer 1

Ca(OH)2+NaOH--->не идет

P2O3+Ca(OH)2=Ca(PO2)2+H2O
Fe+H2SO4--->FeSO4+H2
FeSO4+2NaOH--->Fe(OH)2+Na2SO4
Fe(OH)2--->FeO+H2O
FeO+2HNO3--->Fe(NO3)2+H2O

Answer 2

Chemical Reactions:

The given chemical equation is:

Ca(OH)2 + NaOH -> Ca(OH)2 + P2O3 -> Fe -> FeSO4 -> Fe(OH)2 -> FeO -> Fe(NO3)2

Let's break down the reaction step by step:

1. Ca(OH)2 + NaOH -> Ca(OH)2 + P2O3: - In this step, calcium hydroxide (Ca(OH)2) reacts with sodium hydroxide (NaOH) to form calcium hydroxide (Ca(OH)2) and phosphorus trioxide (P2O3).

2. Ca(OH)2 + P2O3 -> Fe: - In this step, calcium hydroxide (Ca(OH)2) reacts with phosphorus trioxide (P2O3) to form iron (Fe).

3. Fe -> FeSO4: - In this step, iron (Fe) reacts with sulfuric acid (H2SO4) to form iron(II) sulfate (FeSO4).

4. FeSO4 -> Fe(OH)2: - In this step, iron(II) sulfate (FeSO4) reacts with sodium hydroxide (NaOH) to form iron(II) hydroxide (Fe(OH)2).

5. Fe(OH)2 -> FeO: - In this step, iron(II) hydroxide (Fe(OH)2) undergoes dehydration to form iron(II) oxide (FeO).

6. FeO -> Fe(NO3)2: - In this step, iron(II) oxide (FeO) reacts with nitric acid (HNO3) to form iron(II) nitrate (Fe(NO3)2).

Please note that the given chemical equation does not provide any information about the reaction conditions, such as temperature, pressure, or catalysts. These factors can significantly affect the reaction outcomes.