Question

CaO+...=Ca(OH)2 Ca(OH)2+...=Ca(Na3)2 KO+...=KOH KOH+...=K2SO4

Answer 1

Ca(OH)2+2HNO3=Ca(NO3)2+2H2O
K2O+H2O=2KOH
2KOH+H2SO4=K2SO4+2H2O

Answer 2

The given equation is not balanced, but it seems to be a series of chemical reactions involving different compounds. Let's break it down step by step:

1. CaO + H2O → Ca(OH)2 This is a reaction between calcium oxide (CaO) and water (H2O) to produce calcium hydroxide (Ca(OH)2).

2. Ca(OH)2 + Ca(OH)2 → Ca(Na3)2 + KOH + ... It is unclear what the exact reaction is here, as the rest of the equation is not provided. Please provide more information or the complete equation for further analysis.

3. KOH + KOH → KOH + KOH + ... Again, it is unclear what the complete reaction is here. Please provide more information or the complete equation for further analysis.

4. KOH + K2SO4 → KOH + K2SO4 This equation is not balanced. The reaction between potassium hydroxide (KOH) and potassium sulfate (K2SO4) should produce potassium hydroxide and potassium sulfate as the products. However, the equation is not balanced, and the products are the same as the reactants. Please provide more information or the complete equation for further analysis.

In summary, the given equation is incomplete and not balanced. Please provide more information or the complete equation for a more accurate analysis.