Question

CaO-CaC2-C2H2-CH3COH-CH3COOH-(CH3COO)3Ca

Answer 1

CaO + 3C = CaC2 + CO

CaC2 + 2HOH = Ca(OH)2 + C2H2

C2H2 + HOH (HgSO4) = CH3COH

CH3COH + Ag2O = CH3COOH + 2Ag

2CH3COOH + Ca = (CH3COO)2Ca + H2

Answer 2

The series of chemical compounds you've listed represents a sequence of reactions involving calcium oxide (CaO), calcium carbide (CaC2), acetylene (C2H2), acetaldehyde (CH3COH), acetic acid (CH3COOH), and calcium acetate ((CH3COO)3Ca). These reactions involve the formation of various organic and inorganic compounds. Here's a brief explanation of the reactions involved:

1. CaO (Calcium Oxide): Calcium oxide is a chemical compound commonly known as quicklime. It is a strong base and can react with water to form calcium hydroxide (Ca(OH)2).

2. CaC2 (Calcium Carbide): Calcium carbide is a compound that can react with water to produce acetylene gas (C2H2).

3. C2H2 (Acetylene): Acetylene is an organic compound and a flammable gas. It can undergo various reactions, including combustion.

4. CH3COH (Acetaldehyde): Acetylene (C2H2) can be further reacted to form acetaldehyde (CH3CHO), which is an organic compound.

5. CH3COOH (Acetic Acid): Acetaldehyde (CH3CHO) can be further oxidized to produce acetic acid (CH3COOH).

6. (CH3COO)3Ca (Calcium Acetate): Acetic acid (CH3COOH) can react with calcium oxide (CaO) to form calcium acetate, which is a calcium salt of acetic acid.

It's important to note that these reactions can be more complex and might involve various conditions, catalysts, and intermediate steps. If you have specific questions about any of these reactions or need more detailed information about a particular step, please feel free to ask.