Вопрос задан 25.10.2023 в 00:15. Предмет Химия. Спрашивает Шорина София.

CH3-CH2-CH(ch3)-ch(ch3)-ch2-oh

0 0
Перейти к ответам

Ответы на вопрос

Внимание! Ответы на вопросы дают живые люди. Они могут содержать ошибочную информацию, заблуждения, а также ответы могут быть сгенерированы нейросетями. Будьте внимательны. Если вы уверены, что ответ неверный, нажмите кнопку "Пожаловаться" под ответом.
Отвечает Тишков Илья.

Ответ:

2-метилпропанол-1

Объяснение:

0 0
Отвечает нейросеть ChatGpt. Будьте внимательны, ответы нейросети могут содержать ошибочные или выдуманные данные.

It seems like you're trying to represent a chemical compound using a structural formula. The representation you provided corresponds to a molecule with six carbon atoms, fourteen hydrogen atoms, and one oxygen atom. Based on the structure you provided, the compound can be named as follows:

2-methylpentan-2-ol

Here's a breakdown of the name:

  • 2-methyl: There is a methyl group (CH3-) attached to the second carbon atom of the main chain.
  • pentan: The main chain consists of five carbon atoms, so it is called pentane.
  • -2-ol: There is an alcohol functional group (-OH) attached to the second carbon atom of the main chain.

So, the compound you provided is 2-methylpentan-2-ol.

0 0

Похожие вопросы

Топ вопросов за вчера в категории Химия

Последние заданные вопросы в категории Химия

Задать вопрос