Question

P=P2O5=H3PO4=Ca(PO4)2=H3PO4=Ca(H2(PO4)2)

Answer 1

Решение:

  1)          2)             3)                 4)            5)

P → P₂O₅ → H₃PO₄ → Ca₃(PO₄)₂ → H₃PO₄ → Ca(H₂PO₄)₂

1) 4P + 5O₂ → 2P₂O₅

2) P₂O₅ + 3H₂O → 2H₃PO₄

3) 2H₃PO₄ + 3Ca(OH)₂ → Ca₃(PO₄)₂↓ + 6H₂O

4) Ca₃(PO₄)₂ + 3H₂SO₄ → 3CaSO₄ + 2H₃PO₄

5) 2H₃PO₄ + Ca → Ca(H₂PO₄)₂ + H₂↑

Решено от : $DK954$

Answer 2

The chemical equation you've provided seems to represent various chemical compounds involving phosphorus and oxygen. Let's break it down step by step:

1. P: This represents elemental phosphorus, which exists as P4 molecules.

2. P2O5: This is diphosphorus pentoxide, a white, powdery substance that consists of two phosphorus atoms and five oxygen atoms bonded together. Its chemical formula is P4O10.

3. H3PO4: This is phosphoric acid, which is a common inorganic acid. Its chemical formula is H3PO4, indicating that it contains three hydrogen atoms, one phosphorus atom, and four oxygen atoms.

4. Ca(PO4)2: This is calcium phosphate, a compound that contains one calcium (Ca) atom and two phosphate (PO4) groups. Its chemical formula is Ca3(PO4)2.

5. H3PO4: As mentioned earlier, this is phosphoric acid.

6. Ca(H2(PO4)2): This is calcium dihydrogen phosphate or calcium hydrogen phosphate, depending on the specific arrangement of hydrogen atoms. Its chemical formula can be written as Ca(H2PO4)2 or CaHPO4.

It appears you've listed different chemical compounds that contain phosphorus and oxygen. Each compound has its own unique properties and uses in chemistry and various industries. If you have specific questions about any of these compounds or their properties, please feel free to ask.