Question

1)C-O-C 2) C-C-C-C-OH 3) C-C-C-C(O)-H 4)C-C-C-C(O)-O-C-C 5) C-C-C(O)-H ЧТО ЭТО ?

Answer 1

Ну, смотрите, мы же можем обозвать эти вещества, не паникуя...
Тут нет двойных связей, значит везде припишите водороды соответственно валентности углерода. Получите:
1) CH3-O-CH3  диметиловый эфир
2) CH3-CH2-CH2-CH2-OH  бутанол-1
3) CH3-CH2-CH2-CH=O  бутаналь
4) CH3-CH2-CH2-C(O)-O-CH2-CH3 тоже узнаваемо, этиловый эфир бутановой кислоты. Кстати, бутановая кислоты называется еще масляная
5) CH3-CH2-CH=O  пропаналь

Answer 2

Compound Identification

The compounds you provided are:

1) C-O-C 2) C-C-C-C-OH 3) C-C-C-C(O)-H 4) C-C-C-C(O)-O-C-C 5) C-C-C(O)-H

Let's break down each compound and identify them.

1) C-O-C: - This compound consists of a carbon atom bonded to an oxygen atom, which is then bonded to another carbon atom. It can be classified as an ether compound. - Compound 1 is an ether.

2) C-C-C-C-OH: - This compound consists of a chain of four carbon atoms, with a hydroxyl group (-OH) attached to the last carbon atom. - Compound 2 is an alcohol.

3) C-C-C-C(O)-H: - This compound consists of a chain of four carbon atoms, with a carbonyl group (C=O) attached to the last carbon atom, and a hydrogen atom (-H) attached to the carbonyl carbon. - Compound 3 is an aldehyde.

4) C-C-C-C(O)-O-C-C: - This compound consists of a chain of four carbon atoms, with a carbonyl group (C=O) attached to the third carbon atom, and an ester group (-O-C-) attached to the carbonyl carbon. - Compound 4 is an ester.

5) C-C-C(O)-H: - This compound consists of a chain of three carbon atoms, with a carbonyl group (C=O) attached to the third carbon atom, and a hydrogen atom (-H) attached to the carbonyl carbon. - Compound 5 is a ketone.

To summarize: 1) C-O-C is an ether. 2) C-C-C-C-OH is an alcohol. 3) C-C-C-C(O)-H is an aldehyde. 4) C-C-C-C(O)-O-C-C is an ester. 5) C-C-C(O)-H is a ketone.

Please note that the information provided is based on the chemical structure of the compounds and their functional groups.