Question

CH3-C≡C-CH2-CH3+2HCl=

Answer 1

СН3-С=-С-СН2-СН3 + 2НCl=CH3-CH2-C(Cl)(Cl)-CH2-CH3

Answer 2

The reaction you provided seems to be an addition reaction of an alkene with hydrogen chloride (HCl), which is a type of electrophilic addition reaction. The specific reaction you mentioned involves the alkene propyne (CH3-C≡C-CH3) and two molecules of hydrogen chloride (2HCl). Let's see how this reaction proceeds:

CH3-C≡C-CH2-CH3 + 2HCl → CH3-CH(Cl)-CH2-CH3

The product of the reaction is 2-chloropropane (CH3-CH(Cl)-CH2-CH3). In this addition reaction, the hydrogen chloride (HCl) adds across the triple bond of the propyne (CH3-C≡C-CH3) to form a new carbon-chlorine (C-Cl) bond and convert the triple bond into a single bond.

If you have any more reactions or questions, feel free to ask!