Question

CH3-CH(CH3)-CH(CH3)-CH3+Cl2? срочноооо

Answer 1

Ответ:

CH3-CH(CH3)-CH(CH3)-CH3+Cl2=

CH3-CH(CL)-CH(Cl)-CH3 + 3H2

Answer 2

Прошлый ответчик не прав. Правая часть должна быть такая, если взаимодействует 1 моль хлораCH3-CCl(CH3)-CH(CH3)-CH3+HCl

Answer 3

It appears that you are asking about the reaction of a hydrocarbon compound with chlorine gas (Cl2). The hydrocarbon compound you provided is 2,2-dimethylbutane, and the reaction involves chlorination. The balanced chemical equation for this reaction is as follows:

C5H12 + Cl2 -> C5H11Cl + HCl

In this reaction, chlorine gas (Cl2) reacts with 2,2-dimethylbutane (C5H12) to produce 2-chloro-2,3-dimethylbutane (C5H11Cl) and hydrogen chloride gas (HCl) as a byproduct.

If you have any specific questions about this reaction or need further assistance, feel free to ask!