Question

NiCl2+2NaOH 2H3PO4+6NaOH

Answer 1

NiCl2+2NaOH=Ni(OH)2+2NaCl

2H3PO4+6NaOH=2Na3PO4+3H2O

Answer 2

The two chemical equations you provided seem to be incomplete. However, I can help you balance them and provide some context:

1. NiCl2 + 2NaOH → ??? This equation represents a reaction between nickel(II) chloride (NiCl2) and sodium hydroxide (NaOH). The products of this reaction will depend on the reactants. To balance the equation and determine the products, we need additional information about the reaction.

2. 2H3PO4 + 6NaOH → ??? This equation represents a reaction between phosphoric acid (H3PO4) and sodium hydroxide (NaOH). To balance the equation, we first need to recognize that H3PO4 has three acidic hydrogen atoms. The reaction would proceed as follows:

2H3PO4 + 6NaOH → Na3PO4 + 6H2O

In this balanced equation, phosphoric acid reacts with sodium hydroxide to produce sodium phosphate (Na3PO4) and water (H2O).

If you have additional information or specific reactions in mind, feel free to provide more details, and I'll be happy to assist further.