Cr-Cr2O3-Cr2(SO4)3-Cr(OH)3-Cr2O3
Ответы на вопрос
Cr-Cr2O3-Cr2(SO4)3-Cr(OH)3-Cr2O3
1) 4 Cr + 3 O2 → 2 Cr2O3
2)Cr2O3 + 3 H2SO4 → 3 H2O + Cr2(SO4)3
3)Cr2(SO4)3 + 6 NaOH → 3 Na2SO4 + 2 Cr(OH)3
4) 2 Cr(OH)3 → 3 H2O + Cr2O3
It seems like you've provided a list of chemical compounds involving chromium (Cr) and its various oxidation states. Let's break down each compound:
Cr: This is the chemical symbol for chromium, an element commonly used in various industrial applications and alloys.
Cr2O3: Chromium(III) oxide, also known as chromium sesquioxide or chromia. It's a compound where chromium is in the +3 oxidation state. It's often used as a refractory material and in pigments (green color).
Cr2(SO4)3: This represents chromium(III) sulfate, where chromium is again in the +3 oxidation state. It's a chemical compound used in various industrial processes and as a mordant (a substance used to set dyes in fabrics).
Cr(OH)3: This stands for chromium(III) hydroxide, where chromium is in the +3 oxidation state. It's a green precipitate that forms when a solution containing chromium(III) ions is treated with a base.
Cr2O3: This compound was mentioned earlier as chromium(III) oxide. It's possible that this compound is mentioned twice in your list by mistake.
It seems like you've provided a sequence of compounds involving chromium in its +3 oxidation state, with some repetition. If you have a specific question or topic you'd like to explore related to these compounds, please let me know!
Похожие вопросы
Топ вопросов за вчера в категории Химия
Последние заданные вопросы в категории Химия
-
Математика
-
Литература
-
Алгебра
-
Русский язык
-
Геометрия
-
Английский язык
-
Химия
-
Физика
-
Биология
-
Другие предметы
-
История
-
Обществознание
-
Окружающий мир
-
География
-
Українська мова
-
Информатика
-
Українська література
-
Қазақ тiлi
-
Экономика
-
Музыка
-
Право
-
Беларуская мова
-
Французский язык
-
Немецкий язык
-
МХК
-
ОБЖ
-
Психология
-
Физкультура и спорт
-
Астрономия
-
Кыргыз тили
-
Оʻzbek tili
