Question

Cr2(SO4)3-Cr(OH)3-Cr2O3-Cr-CrCl3​

Answer 1

Ответ:

Cr2(SO4)3 → Cr(OH)3 → Cr2O3 → Cr → CrCl3

1. Cr2(SO4)3 + 6KOH → 2Cr(OH)3 + 3K2SO4
2. 2Cr(OH)3 → Cr2O3 + 3H2O
3. 2Cr2O3 → 4Cr + 3O2
4. 3Cl + Cr → CrCl3

Answer 2

The compound series you provided is related to different oxidation states of chromium and its corresponding compounds. Let's break it down step by step:

1. Cr2(SO4)3: This compound is chromium(III) sulfate. It consists of two chromium ions with a +3 oxidation state combined with three sulfate ions (SO4^2-) to balance the charges.

2. Cr(OH)3: This compound is chromium(III) hydroxide. It contains a chromium ion with a +3 oxidation state combined with three hydroxide ions (OH-) to balance the charges.

3. Cr2O3: This compound is chromium(III) oxide. It consists of two chromium ions with a +3 oxidation state combined with three oxide ions (O^2-) to balance the charges.

4. Cr: This symbol represents elemental chromium, which has an oxidation state of 0.

5. CrCl3: This compound is chromium(III) chloride. It contains a chromium ion with a +3 oxidation state combined with three chloride ions (Cl-) to balance the charges.

Overall, the series represents different compounds of chromium in different oxidation states: chromium(III) sulfate, chromium(III) hydroxide, chromium(III) oxide, elemental chromium, and chromium(III) chloride.