Question

CH3-CH(CH3)-NH2 CH3-CH(CH3)-CH2-NH2(CH3-CH2)2NHCH3-CH(NH2)-CH2-CH31-аміно-2-метилпропанізопропіламіндіетиламін2-амінобутанпропіламін​

Answer 1

Ответ:

1) ізопропіламін

2) 1-аміно-2-метилпропан

3) діетиламін

4) 2-амінобутан

Answer 2

The chemical structures you've provided are representations of different amines. Let's name each compound according to IUPAC nomenclature:

1. CH3-CH(CH3)-NH2 is called 2-Aminopropane or Isopropylamine.

2. CH3-CH(CH3)-CH2-NH2 is N-Ethyl-2-aminopropane, since it is a derivative of 2-aminopropane with an ethyl group attached to the nitrogen atom.

3. (CH3-CH2)2NH is Diethylamine, as it consists of two ethyl groups attached to a central nitrogen atom.

4. CH3-CH(NH2)-CH2-CH3 is 2-Aminobutane.

5. 1-аміно-2-метилпропанізопропіламіндіетиламін2-амінобутанпропіламін is the translated IUPAC names for the compounds, which might be the same as the ones listed above but in a different language (possibly Ukrainian or Russian).

If you have any specific questions about these compounds or need further information, please let me know.

Answer 3

The chemical structures you've provided are as follows:

1. CH3-CH(CH3)-NH2 - This is 1-amino-2-methylpropane or isopropylamine.
2. CH3-CH(CH3)-CH2-NH2 - This is diethylamine.
3. (CH3-CH2)2NH - This is diethylamine.
4. CH3-CH(NH2)-CH2-CH3 - This is 1-aminobutane or propylamine.

To clarify:

• CH3-CH(CH3)-NH2 is isopropylamine.
• CH3-CH(CH3)-CH2-NH2 and (CH3-CH2)2NH are both diethylamine.
• CH3-CH(NH2)-CH2-CH3 is propylamine.

Is there anything specific you would like to know or discuss regarding these compounds?