Question

K²O+H²O помогите пожалуста

Answer 1

Ответ:

K2O+H2O=2KOH

3Na2O+2H3PO4=2Na3PO4+3H2O

Ba(OH)2+2HNO2=Ba(NO2)2+2H2O

Answer 2

K₂O + H₂O is a chemical equation that represents the reaction between potassium oxide (K₂O) and water (H₂O). When potassium oxide is added to water, it undergoes a chemical reaction to form potassium hydroxide (KOH).

The balanced chemical equation for this reaction is:

K₂O + H₂O → 2KOH

In this reaction, one molecule of potassium oxide reacts with one molecule of water to produce two molecules of potassium hydroxide.

Potassium hydroxide (KOH) is a strong base that is commonly used in various industrial processes and laboratory applications. It is highly soluble in water and forms a strong alkaline solution. Potassium hydroxide is also known as caustic potash.