Question

Cu(HO)2---CoCO3---CuO---Cu---Cu(NO3)2---CuO---CuSO4

Answer 1

Cu(OH)2+CO2=CuCO3+H2O

CuCO3=CuO+CO2

CuO+Mg=MgO+Cu

Cu+4HNO3=Cu(NO3)2+2NO2+2H2O

2Cu(NO3)2=2CuO+4NO2+O2

CuO+H2SO4=CuSO4+H2O

Answer 2

The chemical reaction pathway depicted in the question is incomplete and somewhat unclear. However, I can provide some information based on what I can infer.

Assuming the question is presenting a series of reactions starting with copper hydroxide (Cu(OH)2) and ending with copper sulfate (CuSO4), the possible complete reaction pathway could be:

Cu(OH)2 → CuCO3 + H2O (1) CuCO3 → CuO + CO2 (2) 2CuO + C → 2Cu + CO2 (3) Cu + HNO3 → Cu(NO3)2 + H2O (4) Cu(NO3)2 + NaOH → Cu(OH)2 + 2NaNO3 (5) Cu(OH)2 → CuO + H2O (6) CuO + H2SO4 → CuSO4 + H2O (7)

Equation (1) shows the decomposition of copper hydroxide to copper carbonate and water. Equation (2) represents the thermal decomposition of copper carbonate to copper oxide and carbon dioxide. Equation (3) shows the reduction of copper oxide using carbon to produce copper metal and carbon dioxide. Equation (4) shows the reaction between copper metal and nitric acid to produce copper(II) nitrate and water. Equation (5) shows the reaction between copper(II) nitrate and sodium hydroxide to produce copper hydroxide and sodium nitrate. Equation (6) represents the thermal decomposition of copper hydroxide to copper oxide and water. Finally, equation (7) shows the reaction between copper oxide and sulfuric acid to produce copper sulfate and water.

Note that this reaction pathway is just one possible interpretation based on the limited information provided in the question. The actual pathway may differ depending on the specific conditions and reactants involved.