Question

N2-Li3N-NO-NO2-HNO3-Cu(NO3)2

Answer 1

Здравствуйте.
      ₁          ₂             ₃         ₄               ₅
N₂ → Li₃N → NO → NO₂ → HNO₃ → Cu(NO₃)₂
 
1. 6Li + 3N₂ = 2Li₃ N
2. Невозможно получить оксид азота (ll) из нитрида лития сразу же. Поэтому произведём её в две стадии:
    Li₃N + 3H₂O = 3LiOH + NH₃
                     кат, t
    4NH₃ + 5O₂ = 4NO + 6H₂O
3. 2NO + O₂ = 2NO₂
4.  4NO₂  + O₂  + 2H₂ O = 4HNO₃
5. Cu + 2HNO₃ = Cu(NO₃)₂ + H₂O

Answer 2

The series of compounds you provided are as follows:

1. N2: This represents a molecule of nitrogen gas, which is composed of two nitrogen atoms bonded together.

2. Li3N: This compound is lithium nitride. It consists of three lithium atoms bonded to a nitrogen atom.

3. NO: This is nitric oxide, a diatomic molecule composed of one nitrogen atom bonded to an oxygen atom.

4. NO2: This represents nitrogen dioxide, which consists of one nitrogen atom bonded to two oxygen atoms.

5. HNO3: This is nitric acid, a strong acid commonly used in laboratories and industrial processes. It consists of one nitrogen atom bonded to three oxygen atoms, with one of the oxygen atoms bonded to a hydrogen atom.

6. Cu(NO3)2: This compound is copper(II) nitrate. It consists of one copper ion (Cu2+) bonded to two nitrate ions (NO3-). The nitrate ion consists of one nitrogen atom bonded to three oxygen atoms.

Each compound listed above represents a different chemical species with distinct properties and characteristics. Is there anything specific you would like to know about these compounds?