Question

Bi(no3)3+na2(sn(oh)4)+naoh

Answer 1

2 Bi(NO3)3 + 3 Na2[Sn(OH)4] + 6 NaOH = 2 Bi + 3 Na2[Sn(OH)6] + 6 NaNO 3

Answer 2

The given chemical equation is not balanced, but I assume you're trying to combine the following compounds: bismuth nitrate (Bi(NO3)3), sodium stannate (Na2Sn(OH)6), and sodium hydroxide (NaOH).

To balance the equation, let's first write out the formula for each compound correctly:

Bi(NO3)3 + Na2Sn(OH)6 + NaOH →

Now let's balance the equation by adjusting the coefficients:

2Bi(NO3)3 + 3Na2Sn(OH)6 + 18NaOH →

Now the equation is balanced. The coefficients in front of each compound represent the number of molecules or formula units required to balance the equation. In this case, we have 2 molecules of bismuth nitrate, 3 formula units of sodium stannate, and 18 molecules of sodium hydroxide.