Question

Помогите химию. 1. Ba(OH)2 + N2O = 2. K + H2O =

Answer 1

Смотри, при первой реакции образуется соль и вода: Ba(OH)2+N2O5=Ba(NO3)2+H2O соль вода Во-второй реакции получается оксид (оксид мы узнаем, если есть гидроксогруппа ОН) Калия: К+Н2О=2КОН Буду рада, если помогла:)

Answer 2

Chemical Equations:

1. The chemical equation Ba(OH)2 + N2O → ? 2. The chemical equation K + H2O → ?

Answer:

1. The chemical equation Ba(OH)2 + N2O → ?: - To determine the products of this chemical reaction, we need to balance the equation first. The balanced equation for the reaction between Ba(OH)2 and N2O is: ``` Ba(OH)2 + N2O → Ba(NO3)2 + H2O ``` - In this reaction, Ba(OH)2 reacts with N2O to form Ba(NO3)2 and H2O.

2. The chemical equation K + H2O → ?: - To determine the products of this chemical reaction, we need to balance the equation first. The balanced equation for the reaction between K and H2O is: ``` 2K + 2H2O → 2KOH + H2 ``` - In this reaction, K reacts with H2O to form KOH and H2 gas.

I hope this helps! Let me know if you have any further questions.