Question

R-OH, CH тройная связь CH, С10 H22, CH3 двойная связь CH2 Что это за соединения?

Answer 1

1-это спирт;этин;декан;скорее всего этен

Answer 2

Chemical Compounds Identification

The given compounds can be identified as follows:

1. R-OH: This represents an alcohol compound, specifically CH3-CH2-OH.

2. CH triple bond CH: This represents an alkyne compound, specifically HCC-CH-CH=C-CH3 [[5]](https://uchi.ru/otvety/questions/hc-c-ch-ch-c-ch3-dayte-nazvanie-ch2-ch3).

3. C10H22: This represents a saturated hydrocarbon, specifically CH3-CH2-CH2-CH2-CH(CH3)-CH3 [[3]](https://uchi.ru/otvety/questions/kak-nazivaetsya-ch3-ch2-ch2-ch2-ch-ch3-ch3).

4. CH3 double bond CH2: This represents an alkene compound, specifically H3C-C=CH-CH2-CH3.

Conclusion

The given compounds are an alcohol (R-OH), an alkyne (CH triple bond CH), a saturated hydrocarbon (C10H22), and an alkene (CH3 double bond CH2).