Question

N2=NH3=NO=NO2=HNO3=Cu(NO3)2=CuO

Answer 1

////////////////////////////////////////////////

Answer 2

Chemical Reactions and Equations

The given chemical equation represents a series of reactions involving nitrogen (N2), ammonia (NH3), nitric oxide (NO), nitrogen dioxide (NO2), nitric acid (HNO3), copper nitrate (Cu(NO3)2), and copper oxide (CuO). Let's break down the reactions step by step:

1. N2 + 3H2 → 2NH3 This is the Haber process, where nitrogen and hydrogen react to form ammonia.

2. 4NH3 + 5O2 → 4NO + 6H2O Ammonia reacts with oxygen to produce nitric oxide and water.

3. 2NO + O2 → 2NO2 Nitric oxide reacts with oxygen to form nitrogen dioxide.

4. 4NO2 + O2 + 2H2O → 4HNO3 Nitrogen dioxide reacts with oxygen and water to produce nitric acid.

5. Cu + 4HNO3 → Cu(NO3)2 + 2NO2 + 2H2O Copper reacts with nitric acid to form copper nitrate, nitrogen dioxide, and water.

6. Cu(NO3)2 → CuO + 2NO2 + 1/2O2 Copper nitrate decomposes to form copper oxide, nitrogen dioxide, and oxygen.

The reactions involving ammonia, nitric oxide, nitrogen dioxide, and nitric acid are part of the Ostwald process, which is used to produce nitric acid. Additionally, the reaction involving copper nitrate and copper oxide is a decomposition reaction.

These reactions are fundamental in understanding the behavior of these compounds and their interactions in various chemical processes.

(#1)(#2)(#6)(#10)

Is there anything else you would like to know about these chemical reactions or any other related topic?