Question

получение солей:Помогите пожалуй. только написать разборчиво,спасибо!кислота +Ме HCl+Zn=кислота +основный оксид H2so4+CaO=кисота +основание HNO3+Cr(OH)3=кислотный оксид +щелочь N2O5+Ca(OH)3=кислотный оксид+основный оксид SiO2+CaO=соль+кислота Ca3(po4)2+H2SO4=соль+Ме CuSO4+Fe=соль+щелочь Fe2(SO4)3+NaOH=соль+кислотный оксид(нелетучий) CaCO3+SiO2=соль+соль Al2(SO4)3+BaCl2=Ме+НеМе Fe+Cl2=

Answer 1

P.S.  не забудь отметить лучшее решение***

 

кислота+Ме=соль+водород      2HCl+Zn=ZnCl2+H2

кислота +основный оксид=cоль+вода    H2SO4+CaO=CaSO4 + H2O

кисота +основание=соль+вода    HNO3 + Cr(OH)3 = Cr(NO3)3 + 3H2O

кислотный оксид +щелочь=соль+вода N2O5+Ca(OH)2=Сa(NO3)2+H2O

кислотный оксид+основный оксид=соль  SiO2+CaO=СaSiO3

соль+кислота=соль+кислота  Ca3(PO4)2+3H2SO4=3CaSO4+2H3PO4

соль+Ме=соль+металл CuSO4+Fe=FeSO4+Cu

соль+щелочь=соль+щёлочь Fe2(SO4)3+3NaOH=3Na2SO4+2Fe(OH)3

соль+кислотный оксид(нелетучий)=соль+оксид   CaCO3+SiO2 = CaSiO3+CO2

соль+соль=соль+соль Al2(SO4)3+3BaCl2=3BaSO4+2AlCl3

Ме+НеМе=соль Fe+Cl2=FeCl2

Answer 2

Obtaining Salts: A Detailed Explanation

To understand the process of obtaining salts, it is important to have a basic understanding of acids, bases, and their reactions. Salts are formed when an acid reacts with a base. The reaction between an acid and a base is known as a neutralization reaction. During this reaction, the hydrogen ions (H+) from the acid combine with the hydroxide ions (OH-) from the base to form water (H2O). The remaining ions from the acid and the base combine to form the salt.

Let's break down the given examples and explain the reactions involved:

1. HCl + Zn = In this reaction, hydrochloric acid (HCl) reacts with zinc (Zn). The hydrogen ions (H+) from the acid combine with the zinc metal to form hydrogen gas (H2). The remaining chloride ions (Cl-) combine with the zinc ions (Zn2+) to form zinc chloride (ZnCl2) salt [[1]].

2. H2SO4 + CaO = Here, sulfuric acid (H2SO4) reacts with calcium oxide (CaO). The hydrogen ions (H+) from the acid combine with the oxide ions (O2-) from the base to form water (H2O). The remaining sulfate ions (SO4^2-) combine with the calcium ions (Ca^2+) to form calcium sulfate (CaSO4) salt [[2]].

3. HNO3 + Cr(OH)3 = Nitric acid (HNO3) reacts with chromium hydroxide (Cr(OH)3). The hydrogen ions (H+) from the acid combine with the hydroxide ions (OH-) from the base to form water (H2O). The remaining nitrate ions (NO3-) combine with the chromium ions (Cr^3+) to form chromium nitrate (Cr(NO3)3) salt [[3]].

4. N2O5 + Ca(OH)3 = In this reaction, dinitrogen pentoxide (N2O5) reacts with calcium hydroxide (Ca(OH)2). The nitrogen oxide (N2O5) is an acidic oxide. It reacts with the hydroxide ions (OH-) from the base to form water (H2O). The remaining nitrate ions (NO3-) combine with the calcium ions (Ca^2+) to form calcium nitrate (Ca(NO3)2) salt [[4]].

5. SiO2 + CaO = Silicon dioxide (SiO2) reacts with calcium oxide (CaO). Silicon dioxide is an acidic oxide. It reacts with the oxide ions (O2-) from the base to form silicate ions (SiO4^4-). The calcium ions (Ca^2+) combine with the silicate ions to form calcium silicate (CaSiO3) salt [[5]].

6. Ca3(PO4)2 + H2SO4 = Calcium phosphate (Ca3(PO4)2) reacts with sulfuric acid (H2SO4). The hydrogen ions (H+) from the acid combine with the phosphate ions (PO4^3-) to form phosphoric acid (H3PO4). The remaining calcium ions (Ca^2+) combine with the sulfate ions (SO4^2-) to form calcium sulfate (CaSO4) salt [[6]].

7. CuSO4 + Fe = Copper sulfate (CuSO4) reacts with iron (Fe). The copper ions (Cu^2+) from the salt combine with the iron metal to form iron ions (Fe^2+) and copper metal (Cu). This reaction does not involve acids or bases [[7]].

8. Fe2(SO4)3 + NaOH = Iron(III) sulfate (Fe2(SO4)3) reacts with sodium hydroxide (NaOH). The hydroxide ions (OH-) from the base combine with the iron(III) ions (Fe^3+) to form iron(III) hydroxide (Fe(OH)3). The remaining sulfate ions (SO4^2-) combine with the sodium ions (Na^+) to form sodium sulfate (Na2SO4) salt [[8]].

9. CaCO3 + SiO2 = Calcium carbonate (CaCO3) reacts with silicon dioxide (SiO2). This reaction does not involve acids or bases. Instead, it is a reaction between a carbonate and an oxide. The calcium ions (Ca^2+) combine with the carbonate ions (CO3^2-) to form calcium carbonate (CaCO3) salt [[9]].

10. Al2(SO4)3 + BaCl2 = Aluminum sulfate (Al2(SO4)3) reacts with barium chloride (BaCl2). The sulfate ions (SO4^2-) from the salt combine with the barium ions (Ba^2+) to form barium sulfate (BaSO4) salt. The remaining aluminum ions (Al^3+) combine with the chloride ions (Cl-) to form aluminum chloride (AlCl3) salt [[10]].

11. Fe + Cl2 = Iron (Fe) reacts with chlorine gas (