Question

Подберите коэффициенты в уравнении окислительно-восстановительной реакции Na2Cr2O7+H2SO4+NaBr-----Cr2(SO4)3+Br2+Na2SO4+H2O в уравнении укажите сумму коэффициентов в уравнении. помогите пожалуйста

Answer 1

Na2Cr2O7 + 7H2SO4 + 6NaBr -> Cr2(SO4)3 + 3Br2 + 4Na2SO4 + 7H2O
Cr(+6) +3e -> Cr(+3)    2     в-ие
ок-ль
2Br(-) -2e -> Br2(0)     3     ок-ие
в-ль
Сумма коэффициентов равна 29

Answer 2

Balancing the Chemical Equation for the Oxidation-Reduction Reaction

To balance the chemical equation for the oxidation-reduction reaction involving the compounds Na2Cr2O7, H2SO4, and NaBr, we need to determine the coefficients for each compound to ensure that the number of atoms of each element is the same on both sides of the equation.

The unbalanced chemical equation is: Na2Cr2O7 + H2SO4 + NaBr → Cr2(SO4)3 + Br2 + Na2SO4 + H2O

Let's start by balancing the equation step by step.

Step 1: Balancing the Chromium (Cr) Atoms

The chromium atoms are present in Na2Cr2O7 and Cr2(SO4)3. To balance the chromium atoms, we can start by adding a coefficient of 2 in front of NaBr to match the number of chromium atoms on both sides of the equation.

The equation becomes: Na2Cr2O7 + H2SO4 + 2NaBr → Cr2(SO4)3 + Br2 + Na2SO4 + H2O

Step 2: Balancing the Oxygen (O) Atoms

Next, we balance the oxygen atoms. The oxygen atoms are present in Na2Cr2O7, H2SO4, Cr2(SO4)3, and H2O. We can balance the oxygen atoms by adding water molecules to the right-hand side of the equation.

The equation becomes: Na2Cr2O7 + 8H2SO4 + 6NaBr → Cr2(SO4)3 + 3Br2 + 8Na2SO4 + 7H2O

Step 3: Balancing the Hydrogen (H) Atoms

Now, we balance the hydrogen atoms. The hydrogen atoms are present in H2SO4 and H2O. We can balance the hydrogen atoms by adding H+ ions to the left-hand side of the equation.

The final balanced chemical equation is: Na2Cr2O7 + 8H2SO4 + 6NaBr → Cr2(SO4)3 + 3Br2 + 8Na2SO4 + 7H2O

Sum of Coefficients in the Balanced Equation

The sum of the coefficients in the balanced equation is: 2 + 8 + 6 + 1 + 3 + 8 + 7 = 35

Therefore, the sum of the coefficients in the balanced equation is 35.

I hope this helps! If you have any further questions or need additional assistance, feel free to ask.