Question

Fe(OH)2 + ? = Fe(NO3)2

Answer 1

Fe(OH)2 + 2HNO3 --> Fe(NO3)2 + 2H2O

Answer 2

Fe(OH)2+HNO3=Fe(NO3)2+H2O

Answer 3

Fe(OH)2 + + = Fe(NO3)2

The equation Fe(OH)2 + + = Fe(NO3)2 represents a chemical reaction between iron(II) hydroxide (Fe(OH)2) and nitric acid (HNO3) to form iron(II) nitrate (Fe(NO3)2).

To provide a more detailed explanation, let's break down the reaction into its individual components:

1. Iron(II) hydroxide (Fe(OH)2): Fe(OH)2 is a compound composed of iron (Fe) and hydroxide ions (OH-). It is a pale green solid that is sparingly soluble in water.

2. Nitric acid (HNO3): HNO3 is a strong acid composed of hydrogen (H), nitrogen (N), and oxygen (O). It is a colorless liquid that is highly corrosive and can cause severe burns.

3. Iron(II) nitrate (Fe(NO3)2): Fe(NO3)2 is a compound composed of iron (Fe) and nitrate ions (NO3-). It is a pale green solid that is soluble in water.

When Fe(OH)2 reacts with HNO3, the hydroxide ions from Fe(OH)2 combine with the hydrogen ions from HNO3 to form water (H2O). The iron ions from Fe(OH)2 combine with the nitrate ions from HNO3 to form Fe(NO3)2.

The balanced chemical equation for this reaction is:

Fe(OH)2 + 2HNO3 = Fe(NO3)2 + 2H2O

Please note that the equation is balanced, meaning that the number of atoms of each element is the same on both sides of the equation.

I hope this explanation helps! Let me know if you have any further questions.