Question

Помогите пожалуйста 1) BaSo4->Ba(No3)2 2) NH3->N2 3) N2->NO 4) NO->NO2 5) NO2->HNO3 6) HNO3-> NaNO3 (ОВР) 7) NaNO3-> Na2SO4 Сделайте пожалуйста кто что может

Answer 1

2NH3=N2+3H2
N2+O2=2NO
2NO+O2=2NO2+4NO2+2H2O+O2=4HNO3
HNO3+NaOH=NaNO3+H2O
NaNO3+H2SO4=Na2SO4+2HNO3

Answer 2

BaSo4+2HNo3=Ba(No3)2+H2No3

Answer 3

Balancing Chemical Equations

To balance the given chemical equations, we need to ensure that the number of atoms of each element is the same on both sides of the equation. Let's go through each equation and balance them one by one.

1) BaSO4 -> Ba(NO3)2

To balance this equation, we need to ensure that the number of atoms of each element is the same on both sides. Let's start by balancing the barium (Ba) atoms:

BaSO4 -> Ba(NO3)2

There is one barium atom on the left side, so we need to have one barium atom on the right side as well. We can achieve this by placing a coefficient of 1 in front of Ba(NO3)2:

BaSO4 -> 1 Ba(NO3)2

Next, let's balance the sulfur (S) atoms:

BaSO4 -> 1 Ba(NO3)2

There is one sulfur atom on the left side, so we need to have one sulfur atom on the right side as well. We can achieve this by placing a coefficient of 1 in front of BaSO4:

1 BaSO4 -> 1 Ba(NO3)2

Finally, let's balance the oxygen (O) atoms:

1 BaSO4 -> 1 Ba(NO3)2

There are four oxygen atoms on the left side (2 in BaSO4 and 2 in NO3), so we need to have four oxygen atoms on the right side as well. We can achieve this by placing a coefficient of 2 in front of NO3:

1 BaSO4 -> 1 Ba(NO3)2

Therefore, the balanced equation is:

BaSO4 -> Ba(NO3)2 2) NH3 -> N2

To balance this equation, we need to ensure that the number of atoms of each element is the same on both sides. Let's start by balancing the nitrogen (N) atoms:

NH3 -> N2

There is one nitrogen atom on the left side, so we need to have one nitrogen atom on the right side as well. We can achieve this by placing a coefficient of 2 in front of NH3:

2 NH3 -> N2

Therefore, the balanced equation is:

2 NH3 -> N2 3) N2 -> NO

To balance this equation, we need to ensure that the number of atoms of each element is the same on both sides. Let's start by balancing the nitrogen (N) atoms:

N2 -> NO

There are two nitrogen atoms on the left side, so we need to have two nitrogen atoms on the right side as well. We can achieve this by placing a coefficient of 2 in front of NO:

N2 -> 2 NO

Therefore, the balanced equation is:

N2 -> 2 NO 4) NO -> NO2

To balance this equation, we need to ensure that the number of atoms of each element is the same on both sides. Let's start by balancing the nitrogen (N) atoms:

NO -> NO2

There is one nitrogen atom on the left side, so we need to have one nitrogen atom on the right side as well. We can achieve this by placing a coefficient of 2 in front of NO2:

NO -> 2 NO2

Therefore, the balanced equation is:

NO -> 2 NO2 5) NO2 -> HNO3

To balance this equation, we need to ensure that the number of atoms of each element is the same on both sides. Let's start by balancing the nitrogen (N) atoms:

NO2 -> HNO3

There is one nitrogen atom on the left side, so we need to have one nitrogen atom on the right side as well. We can achieve this by placing a coefficient of 2 in front of HNO3:

NO2 -> 2 HNO3

Therefore, the balanced equation is:

NO2 -> 2 HNO3 6) HNO3 -> NaNO3 (ОВР)

To balance this equation, we need to ensure that the number of atoms of each element is the same on both sides. Let's start by balancing the hydrogen (H) atoms:

HNO3 -> NaNO3

There is one hydrogen atom on the left side, so we need to have one hydrogen atom on the right side as well. We can achieve this by placing a coefficient of 2 in front of HNO3:

2 HNO3 -> NaNO3

Therefore, the balanced equation is:

2 HNO3 -> NaNO3 7) NaNO3 -> Na2SO4

To balance this equation, we need to ensure that the number of atoms of each element is the same on both sides. Let's start by balancing the sodium (Na) atoms:

NaNO3 -> Na2SO4

There is one sodium atom on the left side, so we need to have two sodium atoms on the right side. We can achieve this by placing a coefficient of 2 in front of NaNO3:

2 NaNO3 -> Na2SO4

Therefore, the balanced equation is:

2 NaNO3 -> Na2SO4 I hope this helps! Let me know if you have any further questions.