Вопрос задан 19.10.2018 в 20:06. Предмет Химия. Спрашивает Zhienbayev Nyrlan.

Закончите уравнения следующих реакций Na2CO3+HCL-> NaOH+HCL-> Fe(OH)3-+HNO3->

Mg+H2SO2-> Пожее побыстрее
0 0
Перейти к ответам

Ответы на вопрос

Внимание! Ответы на вопросы дают живые люди. Они могут содержать ошибочную информацию, заблуждения, а также ответы могут быть сгенерированы нейросетями. Будьте внимательны. Если вы уверены, что ответ неверный, нажмите кнопку "Пожаловаться" под ответом.
Отвечает Богданова Юлия.

Na2CO3+2HCl=2NaCl+H2O+CO2

NaOH+HCl=NaCl+H2O

Fe(OH)3+3HNO3=Fe(NO3)3+3H2O

Mg+H2SO3=MgSO3+H2

Может быть H2SO3 или H2SO4

H2SO2 не бывает 

0 0
Отвечает нейросеть ChatGpt. Будьте внимательны, ответы нейросети могут содержать ошибочные или выдуманные данные.

Na2CO3 + HCl -> NaOH + HCl

The reaction between sodium carbonate (Na2CO3) and hydrochloric acid (HCl) can be represented as follows:

Na2CO3 + 2HCl -> 2NaCl + H2O + CO2

In this reaction, sodium carbonate reacts with hydrochloric acid to produce sodium chloride (NaCl), water (H2O), and carbon dioxide (CO2) [[1]].

NaOH + HCl -> ?

The reaction between sodium hydroxide (NaOH) and hydrochloric acid (HCl) can be represented as follows:

NaOH + HCl -> NaCl + H2O

In this reaction, sodium hydroxide reacts with hydrochloric acid to produce sodium chloride (NaCl) and water (H2O) [[2]].

Fe(OH)3- + HNO3 -> ?

The reaction between iron(III) hydroxide (Fe(OH)3) and nitric acid (HNO3) can be represented as follows:

Fe(OH)3 + 3HNO3 -> Fe(NO3)3 + 3H2O

In this reaction, iron(III) hydroxide reacts with nitric acid to produce iron(III) nitrate (Fe(NO3)3) and water (H2O) [[3]].

Mg + H2SO2 -> ?

It seems there might be a typo in the equation you provided. Hydrogen sulfite is typically represented as H2SO3, not H2SO2. Assuming this is the correct formula, the reaction between magnesium (Mg) and hydrogen sulfite (H2SO3) can be represented as follows:

Mg + H2SO3 -> MgSO3 + H2

In this reaction, magnesium reacts with hydrogen sulfite to produce magnesium sulfite (MgSO3) and hydrogen gas (H2) [[4]].

Please note that if the formula you provided for hydrogen sulfite is incorrect, the reaction may be different. Could you please confirm the correct formula for hydrogen sulfite?

Please note that the equations provided are simplified representations of the reactions and may not account for all possible reaction products or conditions.

0 0

Топ вопросов за вчера в категории Химия

Химия 77 Чебанова Анастасия

Последние заданные вопросы в категории Химия

Задать вопрос