Question

Раствор содержащий 19.6 г серной кислоты нейтрализовали избытком оксида магния.кол-во вещесва образовавщейся соли равно? Помогите с задачей,заранее спасибо

Answer 1

H2SO4 + MgO=MgSO4 +H2O 
n(H2SO4)= n(MgSO4) 
n=m/Mr
n(H2SO4)=m(H2SO4)/Mr(H2SO4)
Mr(H2SO4)=2*1+32+4*16 =98 г/моль
n(H2SO4)= 19,6г/ 98г/моль=0.2 моль
n(MgSO4)=0,2 моль

Answer 2

Calculation of the Amount of Salt Formed

To determine the amount of salt formed when 19.6 g of sulfuric acid (H2SO4) is neutralized with an excess of magnesium oxide (MgO), we need to consider the balanced chemical equation for the reaction between sulfuric acid and magnesium oxide.

The balanced chemical equation for the reaction is:

H2SO4 + MgO → MgSO4 + H2O

From the balanced equation, we can see that one mole of sulfuric acid reacts with one mole of magnesium oxide to produce one mole of magnesium sulfate and one mole of water.

To calculate the amount of salt formed, we need to convert the given mass of sulfuric acid to moles using its molar mass and then use the mole ratio from the balanced equation to determine the moles of magnesium sulfate formed.

1. Calculate the moles of sulfuric acid (H2SO4): - Molar mass of H2SO4 = 2(1.01 g/mol) + 32.07 g/mol + 4(16.00 g/mol) = 98.09 g/mol - Moles of H2SO4 = mass of H2SO4 / molar mass of H2SO4 = 19.6 g / 98.09 g/mol

2. Use the mole ratio from the balanced equation to determine the moles of magnesium sulfate (MgSO4) formed: - From the balanced equation, the mole ratio of H2SO4 to MgSO4 is 1:1. - Therefore, the moles of MgSO4 formed is equal to the moles of H2SO4.

3. Calculate the mass of magnesium sulfate formed: - Mass of MgSO4 = moles of MgSO4 * molar mass of MgSO4

Now, let's calculate the amount of salt formed using the given information.

Calculation:

1. Moles of H2SO4: - Moles of H2SO4 = 19.6 g / 98.09 g/mol = 0.1997 mol

2. Moles of MgSO4 formed: - Moles of MgSO4 = 0.1997 mol

3. Mass of MgSO4 formed: - Molar mass of MgSO4 = 24.31 g/mol + 32.07 g/mol + 4(16.00 g/mol) = 120.37 g/mol - Mass of MgSO4 = 0.1997 mol * 120.37 g/mol

Therefore, the amount of magnesium sulfate formed is approximately 23.99 grams.

Please note that the calculated value is approximate due to rounding off the molar mass of MgSO4 to two decimal places.