Question

Фосфор получают из апатитов и фосфоритов в результате их взаимодействия с коксом и кремнезёмом при температуре 1600с* .Какова сумма коэффицциентов реакции получения фосфора?Ca3(PO4)2+C+SIO2---P4+CO+CaSIO3. вырянты ответа 6,17,35,50

Answer 1

Ca3(PO4)2+C+SIO2---P4+CO+CaSIO3

проставляем ст. ок (только те, что изменились)

Ca3(P(+5)O4)2+4C(0)+SIO2---P(0)4+C(+2)O+CaSIO3

4Р(+5)+5*4е=Р4(0)

 C(0)-2е=C(+2)

2Ca3(PO4)2+10C+6SIO2---P4+10CO+6CaSIO3

ответ 35

Answer 2

Reaction for Phosphorus Production

The reaction for the production of phosphorus from apatite and phosphorite involves their interaction with coke and silica (silicon dioxide) at a temperature of 1600°C. The balanced equation for this reaction is:

Ca3(PO4)2 + 3C + 5SiO2 → 3CaSiO3 + 2P4 + 3CO

In this equation, 1 mole of Ca3(PO4)2 reacts with 3 moles of carbon (C) and 5 moles of silicon dioxide (SiO2) to produce 3 moles of calcium silicate (CaSiO3), 2 moles of phosphorus (P4), and 3 moles of carbon monoxide (CO).

Sum of Reaction Coefficients

To find the sum of the coefficients in the balanced equation, we add up the coefficients of all the reactants and products. In this case, the sum of the coefficients is:

1 + 3 + 5 + 3 + 2 + 3 = 17

Therefore, the sum of the coefficients in the reaction for the production of phosphorus is 17.

So, the correct answer is 17.