Question

Закончите схемы возможных реакций , приведите ионные уравнения AgNO3+KCl= LiOH+BaCl2= CoSO4+Ba(OH)2= Al2(SO4)3+KOH= FeOH3+HCl= MgCO3+H2SO4=

Answer 1

1)AgNO3+KCl=AgCl↓+KNO3
Ag(+)+Cl(-)=AgCl↓
2)LiOH+BaCL2≠
3)CoSO4+Ba(OH)2=Co(OH)2↓+BaSO4↓
Co(2+)+SO4(2-)+Ba(2+)+2OH(-)=Co(OH)2↓+BASO4↓
4)Al2(SO4)3+6KOH=3K2SO4+2Al(OH)3
2Al(3+)+6OH(-)=2Al(OH)3↓
5)Fe(OH)3+3HCl=FeCl3+3H2O
Fe(OH)3+3H(+)=Fe(3+)+3H2O
6)MgCO3+H2SO4=MgSO4+H2O+CO2
MgCO3+2H(+)=Mg(2+)+H2O+CO2

Answer 2

AgNO3 + KCl

The reaction between silver nitrate (AgNO3) and potassium chloride (KCl) results in the formation of silver chloride (AgCl) and potassium nitrate (KNO3).

The balanced ionic equation for this reaction is:

AgNO3 + KCl → AgCl + KNO3

LiOH + BaCl2

The reaction between lithium hydroxide (LiOH) and barium chloride (BaCl2) leads to the formation of lithium chloride (LiCl) and barium hydroxide (Ba(OH)2).

The balanced ionic equation for this reaction is:

2LiOH + BaCl2 → 2LiCl + Ba(OH)2

CoSO4 + Ba(OH)2

The reaction between cobalt(II) sulfate (CoSO4) and barium hydroxide (Ba(OH)2) results in the formation of cobalt(II) hydroxide (Co(OH)2) and barium sulfate (BaSO4).

The balanced ionic equation for this reaction is:

CoSO4 + Ba(OH)2 → Co(OH)2 + BaSO4

Al2(SO4)3 + KOH

The reaction between aluminum sulfate (Al2(SO4)3) and potassium hydroxide (KOH) leads to the formation of aluminum hydroxide (Al(OH)3) and potassium sulfate (K2SO4).

The balanced ionic equation for this reaction is:

Al2(SO4)3 + 6KOH → 2Al(OH)3 + 3K2SO4

Fe(OH)3 + HCl

The reaction between iron(III) hydroxide (Fe(OH)3) and hydrochloric acid (HCl) results in the formation of iron(III) chloride (FeCl3) and water (H2O).

The balanced ionic equation for this reaction is:

Fe(OH)3 + 3HCl → FeCl3 + 3H2O

MgCO3 + H2SO4

The reaction between magnesium carbonate (MgCO3) and sulfuric acid (H2SO4) leads to the formation of magnesium sulfate (MgSO4), carbon dioxide (CO2), and water (H2O).

The balanced chemical equation for this reaction is:

MgCO3 + H2SO4 → MgSO4 + CO2 + H2O

Please note that the above reactions are simplified ionic equations and may not represent the complete reaction mechanisms.