Вопрос задан 27.07.2018 в 13:20. Предмет Химия. Спрашивает Ворфоломеева Виктория.

С помощью уравнения электронного баланса расставить коэффициенты в следующем уравнении реакции

указав окислитель и восстановитель,процесс окисления и восстановления K2CR2O7+H2So4+Na2So3->CR2(SO4)3+NA2SO4+K2SO4+H2O помогите пожалуйста
0 0
Перейти к ответам

Ответы на вопрос

Внимание! Ответы на вопросы дают живые люди. Они могут содержать ошибочную информацию, заблуждения, а также ответы могут быть сгенерированы нейросетями. Будьте внимательны. Если вы уверены, что ответ неверный, нажмите кнопку "Пожаловаться" под ответом.
Отвечает Козлова Анастасия.
K2CR2O7+ 4H2So4+ 3Na2So3-> CR2(SO4)3+ 3NA2SO4+K2SO4+ 4H2O
2Cr(+6) +6e = 2Cr(+3)   1
S(+4) - 2e = S(+6)          3
0 0
Отвечает нейросеть ChatGpt. Будьте внимательны, ответы нейросети могут содержать ошибочные или выдуманные данные.

Balancing the Equation using the Electron Balance Method

To balance the given equation using the electron balance method, we need to ensure that the number of electrons lost in the oxidation half-reaction is equal to the number of electrons gained in the reduction half-reaction. Let's proceed with balancing the equation step by step:

1. Identify the oxidation and reduction half-reactions: - Oxidation half-reaction: K2Cr2O7 -> Cr2(SO4)3 - Reduction half-reaction: Na2SO3 -> Na2SO4

2. Balance the atoms other than hydrogen and oxygen in each half-reaction: - Oxidation half-reaction: K2Cr2O7 -> 2Cr2(SO4)3 - Reduction half-reaction: Na2SO3 -> Na2SO4

3. Balance the oxygen atoms by adding water molecules (H2O) to the side that needs more oxygen: - Oxidation half-reaction: K2Cr2O7 -> 2Cr2(SO4)3 + 7H2O - Reduction half-reaction: Na2SO3 + H2O -> Na2SO4 + H2O

4. Balance the hydrogen atoms by adding hydrogen ions (H+) to the side that needs more hydrogen: - Oxidation half-reaction: K2Cr2O7 + 14H+ -> 2Cr2(SO4)3 + 7H2O - Reduction half-reaction: Na2SO3 + H2O -> Na2SO4 + 2H+ + H2O

5. Balance the charge by adding electrons (e-) to the side that needs more charge: - Oxidation half-reaction: K2Cr2O7 + 14H+ + 6e- -> 2Cr2(SO4)3 + 7H2O - Reduction half-reaction: Na2SO3 + H2O -> Na2SO4 + 2H+ + 2e-

6. Multiply the half-reactions by appropriate coefficients to make the number of electrons equal in both half-reactions: - Oxidation half-reaction: 3K2Cr2O7 + 42H+ + 18e- -> 12Cr2(SO4)3 + 21H2O - Reduction half-reaction: 6Na2SO3 + 3H2O -> 6Na2SO4 + 12H+ + 12e-

7. Add the balanced half-reactions together: - 3K2Cr2O7 + 42H+ + 18Na2SO3 + 9H2O -> 12Cr2(SO4)3 + 21H2O + 6Na2SO4 + 12H+ + 12e-

8. Simplify the equation by canceling out the common terms: - 3K2Cr2O7 + 18Na2SO3 + 9H2O -> 12Cr2(SO4)3 + 21H2O + 6Na2SO4

Summary:

The balanced equation for the given reaction is: 3K2Cr2O7 + 18Na2SO3 + 9H2O -> 12Cr2(SO4)3 + 21H2O + 6Na2SO4

In this reaction, K2Cr2O7 is the oxidizing agent (the substance that gets reduced) and Na2SO3 is the reducing agent (the substance that gets oxidized). The process of oxidation occurs to Na2SO3, which loses electrons and increases its oxidation state, while the process of reduction occurs to K2Cr2O7, which gains electrons and decreases its oxidation state.

Please note that the equation has been balanced using the electron balance method.

0 0

Топ вопросов за вчера в категории Химия

Химия 34 Грибанова Кристина

Последние заданные вопросы в категории Химия

Задать вопрос